Compound details
Scrophuloside A8
| Compound ID | CDAMM02815 |
|---|---|
| Common name | Scrophuloside A8 | IUPAC name | [4,5-diacetyloxy-6-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-2-methyloxan-3-yl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| Molecular formula | C35H44O19 |
| Retention time | 4.68 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 769.248 | Theoretical mz | 769.255 |
| Error | 9.33 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 5.8072 |
| Inchi key | FYTGEKJFCXSGKK-VQOVXIODNA-N |
|---|---|
| Smiles | O=C(OC1C(OC(OC2C3OC3(CO)C4C(OC=CC24)OC5OC(CO)C(O)C(O)C5O)C(OC(=O)C)C1OC(=O)C)C)C=CC6=CC=C(OC)C(O)=C6 |
| Superclass | Phenylpropanoids and polyketides |
| Class | Cinnamic acids and derivatives |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P15692 | VEGFA | Vascular endothelial growth factor A | T20761 | SEA |
| P05230 | FGF1 | Acidic fibroblast growth factor | T18639 | SEA |
| P09038 | FGF2 | Basic fibroblast growth factor | T31621 | SEA |
| P60568 | IL2 | Interleukin-2 | T61698 | SEA |
| P14679 | TYR | Tyrosinase | T97035 | SEA |
| Q9NZ08 | ERAP1 | Endoplasmic reticulum aminopeptidase 1 | T72849 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T20761 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P15692 | VEGFA |
| T20761 | DI0365 | Retinopathy | [ICD-11: 9B71] | P15692 | VEGFA |
| T20761 | DI0430 | Vascular system developmental anomaly | [ICD-11: LA90] | P15692 | VEGFA |
| T18639 | DI0081 | Chronic arterial occlusive disease | [ICD-11: BD4Z] | P05230 | FGF1 |
| T18639 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P05230 | FGF1 |
| T31621 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P09038 | FGF2 |
| T61698 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P60568 | IL2 |
| T61698 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P60568 | IL2 |
| T97035 | DI0007 | Acquired hypermelanosis | [ICD-11: ED60] | P14679 | TYR |
| T97035 | DI0008 | Acquired hypomelanotic disorder | [ICD-11: ED63] | P14679 | TYR |