Compound details
Cucurbitacin I 2-glucoside
| Compound ID | CDAMM02771 |
|---|---|
| Common name | Cucurbitacin I 2-glucoside | IUPAC name | 17-(2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl)-16-hydroxy-4,4,9,13,14-pentamethyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-8,10,12,15,16,17-hexahydro-7H-cyclopenta[a]phenanthrene-3,11-dione |
| Molecular formula | C36H52O12 |
| Retention time | 10.24 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 677.353 | Theoretical mz | 677.353 |
| Error | 0.18 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.8135 |
| Inchi key | LIIOJBIJVPGVGO-VAWYXSNFNA-N |
|---|---|
| Smiles | O=C(C=CC(O)(C)C)C(O)(C)C1C(O)CC2(C)C3CC=C4C(C=C(OC5OC(CO)C(O)C(O)C5O)C(=O)C4(C)C)C3(C(=O)CC12C)C |
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T16347 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P18031 | PTPN1 |
| T16347 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P18031 | PTPN1 |
| T16347 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | P18031 | PTPN1 |
| T16347 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P18031 | PTPN1 |
| T35640 | DI0351 | Psoriasis | [ICD-11: EA90] | P20701 | ITGAL |
| T35640 | DI0436 | Visual system disease | [ICD-11: 9E1Z] | P20701 | ITGAL |