Compound details
Cucurbitacin A
| Compound ID | CDAMM02580 |
|---|---|
| Common name | Cucurbitacin A | IUPAC name | [6-[2,16-dihydroxy-9-(hydroxymethyl)-4,4,13,14-tetramethyl-3,11-dioxo-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-hydroxy-2-methyl-5-oxohept-3-en-2-yl] acetate |
| Molecular formula | C32H46O9 |
| Retention time | 13.41 |
|---|---|
| Adduct | [M+NH4]+ |
| Actual mz | 592.354 | Theoretical mz | 592.348 |
| Error | 10.6 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.2857 |
| Inchi key | IHTCCHVMPGDDSL-JEWXSFAPNA-N |
|---|---|
| Smiles | O=C(OC(C=CC(=O)C(O)(C)C1C(O)CC2(C)C3CC=C4C(CC(O)C(=O)C4(C)C)C3(C(=O)CC12C)CO)(C)C)C |
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P20701 | ITGAL | Intercellular adhesion molecule (ICAM-1), Integrin alpha-L/beta-2 | T35640 | SwissTargetPrediction and SEA |
| P40763 | STAT3 | Signal transducer and activator of transcription 3 | T29130 | SwissTargetPrediction |