Compound details
Cadambine
| Compound ID | CDAMM02551 |
|---|---|
| Common name | Cadambine | IUPAC name | methyl 17-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-18,23-dioxa-3,13-diazahexacyclo[13.7.1.01,13.02,10.04,9.016,21]tricosa-2(10),4,6,8,19-pentaene-20-carboxylate |
| Molecular formula | C27H32N2O10 |
| Retention time | 4.36 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 545.215 | Theoretical mz | 545.213 |
| Error | 3.35 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 7.5023 |
| Inchi key | OVRROYYXOBYCSR-CZAVMTDFNA-N |
|---|---|
| Smiles | O=C(OC)C1=COC(OC2OC(CO)C(O)C(O)C2O)C3C4OC5(C=6NC=7C=CC=CC7C6CCN5C4)CC13 |
| Superclass | Organoheterocyclic compounds |
| Class | Indoles and derivatives |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P11387 | TOP1 | DNA topoisomerase I | T09826 | SEA |
| P15692 | VEGFA | Vascular endothelial growth factor A | T20761 | SEA |
| P05230 | FGF1 | Acidic fibroblast growth factor | T18639 | SEA |
| P09038 | FGF2 | Basic fibroblast growth factor | T31621 | SEA |
| P60568 | IL2 | Interleukin-2 | T61698 | SEA |
| P17931 | LGALS3 | Galectin-3 | T72038 | SEA |
| P20916 | MAG | Myelin-associated glycoprotein (by homology) | T95286 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T09826 | DI0046 | Bacterial infection | [ICD-11: 1A00-1C4Z] | P11387 | TOP1 |
| T09826 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P11387 | TOP1 |
| T09826 | DI0238 | Lung cancer | [ICD-11: 2C25] | P11387 | TOP1 |
| T09826 | DI0321 | Ovarian cancer | [ICD-11: 2C73] | P11387 | TOP1 |
| T09826 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P11387 | TOP1 |
| T20761 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P15692 | VEGFA |
| T20761 | DI0365 | Retinopathy | [ICD-11: 9B71] | P15692 | VEGFA |
| T20761 | DI0430 | Vascular system developmental anomaly | [ICD-11: LA90] | P15692 | VEGFA |
| T18639 | DI0081 | Chronic arterial occlusive disease | [ICD-11: BD4Z] | P05230 | FGF1 |
| T18639 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P05230 | FGF1 |
| T31621 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P09038 | FGF2 |
| T61698 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P60568 | IL2 |
| T61698 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P60568 | IL2 |
| T72038 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | P17931 | LGALS3 |
| T72038 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | P17931 | LGALS3 |
| T72038 | DI0252 | Melanoma | [ICD-11: 2C30] | P17931 | LGALS3 |
| T72038 | DI0302 | Non-alcoholic fatty liver disease | [ICD-11: DB92] | P17931 | LGALS3 |
| T72038 | DI0351 | Psoriasis | [ICD-11: EA90] | P17931 | LGALS3 |
| T95286 | DI0219 | Ischaemic/haemorrhagic stroke | [ICD-11: 8B20] | P20916 | MAG |