Compound details
N-[[3-(b-D-Glucopyranosyloxy)-2,3-dihydro-2-oxo-1H-indol-3-yl]acetyl]aspartic acid
| Compound ID | CDAMM02425 |
|---|---|
| Common name | N-[[3-(b-D-Glucopyranosyloxy)-2,3-dihydro-2-oxo-1H-indol-3-yl]acetyl]aspartic acid | IUPAC name | 2-[[2-[2-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]acetyl]amino]butanedioic acid |
| Molecular formula | C20H24N2O12 |
| Retention time | 12.03 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 485.141 | Theoretical mz | 485.14 |
| Error | 1.9 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 5.7782 |
| Inchi key | ANAVISFXAGVRIA-UHFFFAOYNA-N |
|---|---|
| Smiles | O=C(O)CC(NC(=O)CC1(OC2OC(CO)C(O)C(O)C2O)C(=O)NC=3C=CC=CC31)C(=O)O |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P35968 | KDR | Vascular endothelial growth factor receptor 2 | T80975 | SwissTargetPrediction |
| P11387 | TOP1 | DNA topoisomerase I | T09826 | SEA |
| P15692 | VEGFA | Vascular endothelial growth factor A | T20761 | SEA |
| P05230 | FGF1 | Acidic fibroblast growth factor | T18639 | SEA |
| P09038 | FGF2 | Basic fibroblast growth factor | T31621 | SEA |
| P52789 | HK2 | Hexokinase type II | T96685 | SEA |
| P16109 | SELP | P-selectin | T10965 | SEA |
| P14151 | SELL | Leukocyte adhesion molecule-1 | T60526 | SEA |
| P01112 | HRAS | Transforming protein p21/H-Ras-1 | T71081 | SEA |
| P60568 | IL2 | Interleukin-2 | T61698 | SEA |
| P17931 | LGALS3 | Galectin-3 | T72038 | SEA |
| P14679 | TYR | Tyrosinase | T97035 | SEA |
| P09382 | LGALS1 | Galectin-1 | T09544 | SEA |
| P01111 | NRAS | GTPase NRas | T35486 | SEA |
| Q9NZ08 | ERAP1 | Endoplasmic reticulum aminopeptidase 1 | T72849 | SEA |
| P30837 | ALDH1B1 | Acetaldehyde dehydrogenase | T99641 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T80975 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P35968 | KDR |
| T80975 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P35968 | KDR |
| T80975 | DI0160 | Gastrointestinal stromal tumour | [ICD-11: 2B5B] | P35968 | KDR |
| T80975 | DI0244 | Malignant digestive organ neoplasm | [ICD-11: 2C11] | P35968 | KDR |
| T80975 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P35968 | KDR |
| T80975 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P35968 | KDR |
| T80975 | DI0395 | Stomach cancer | [ICD-11: 2B72] | P35968 | KDR |
| T80975 | DI0403 | Thrombocytopenia | [ICD-11: 3B64] | P35968 | KDR |
| T80975 | DI0407 | Thyroid cancer | [ICD-11: 2D10] | P35968 | KDR |
| T09826 | DI0046 | Bacterial infection | [ICD-11: 1A00-1C4Z] | P11387 | TOP1 |
| T09826 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P11387 | TOP1 |
| T09826 | DI0238 | Lung cancer | [ICD-11: 2C25] | P11387 | TOP1 |
| T09826 | DI0321 | Ovarian cancer | [ICD-11: 2C73] | P11387 | TOP1 |
| T09826 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P11387 | TOP1 |
| T20761 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P15692 | VEGFA |
| T20761 | DI0365 | Retinopathy | [ICD-11: 9B71] | P15692 | VEGFA |
| T20761 | DI0430 | Vascular system developmental anomaly | [ICD-11: LA90] | P15692 | VEGFA |
| T18639 | DI0081 | Chronic arterial occlusive disease | [ICD-11: BD4Z] | P05230 | FGF1 |
| T18639 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P05230 | FGF1 |
| T31621 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P09038 | FGF2 |
| T96685 | DI0133 | Epidermal dysplasias | [ICD-11: EK90] | P52789 | HK2 |
| T10965 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P16109 | SELP |
| T10965 | DI0381 | Sickle-cell disorder | [ICD-11: 3A51] | P16109 | SELP |
| T60526 | DI0037 | Asthma | [ICD-11: CA23] | P14151 | SELL |
| T60526 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P14151 | SELL |
| T61698 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P60568 | IL2 |
| T61698 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P60568 | IL2 |
| T72038 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | P17931 | LGALS3 |
| T72038 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | P17931 | LGALS3 |
| T72038 | DI0252 | Melanoma | [ICD-11: 2C30] | P17931 | LGALS3 |
| T72038 | DI0302 | Non-alcoholic fatty liver disease | [ICD-11: DB92] | P17931 | LGALS3 |
| T72038 | DI0351 | Psoriasis | [ICD-11: EA90] | P17931 | LGALS3 |
| T97035 | DI0007 | Acquired hypermelanosis | [ICD-11: ED60] | P14679 | TYR |
| T97035 | DI0008 | Acquired hypomelanotic disorder | [ICD-11: ED63] | P14679 | TYR |
| T35486 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P01111 | NRAS |
| T35486 | DI0172 | Head and neck cancer | [ICD-11: 2D42] | P01111 | NRAS |
| T35486 | DI0238 | Lung cancer | [ICD-11: 2C25] | P01111 | NRAS |
| T35486 | DI0326 | Pancreatic cancer | [ICD-11: 2C10] | P01111 | NRAS |
| T35486 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P01111 | NRAS |
| T99641 | DI0396 | Substance abuse | [ICD-11: 6C40] | P30837 | ALDH1B1 |