Compound details
Ningpeisinoside
| Compound ID | CDAMM02223 |
|---|---|
| Common name | Ningpeisinoside | IUPAC name | 9-[1-(1,5-dimethylpiperidin-2-yl)ethyl]-10,11b-dimethyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,4a,6,6a,6b,7,8,9,10,10a,11,11a-tetradecahydro-1H-benzo[a]fluoren-5-one |
| Molecular formula | C34H57NO7 |
| Retention time | 9.62 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 592.42 | Theoretical mz | 592.421 |
| Error | 2.32 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 5.1705 |
| Inchi key | OAWUSFAEJKJJFY-MXGSQDAONA-N |
|---|---|
| Smiles | O=C1CC2C3CCC(C(C)C4N(C)CC(C)CC4)C(C)C3CC2C5(C)CCC(OC6OC(CO)C(O)C(O)C6O)CC15 |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T18639 | DI0081 | Chronic arterial occlusive disease | [ICD-11: BD4Z] | P05230 | FGF1 |
| T18639 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P05230 | FGF1 |
| T61698 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P60568 | IL2 |
| T61698 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P60568 | IL2 |
| T97035 | DI0007 | Acquired hypermelanosis | [ICD-11: ED60] | P14679 | TYR |
| T97035 | DI0008 | Acquired hypomelanotic disorder | [ICD-11: ED63] | P14679 | TYR |