Compound details
Lup-20(29)en-28-al-3beta-yl caffeate
| Compound ID | CDAMM01804 |
|---|---|
| Common name | Lup-20(29)en-28-al-3beta-yl caffeate | IUPAC name | (3a-formyl-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Molecular formula | C39H54O5 |
| Retention time | 10.04 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 603.41 | Theoretical mz | 603.404 |
| Error | 9.98 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.5097 |
| Inchi key | GRALPKTVLYGKSY-HJXQZQOMNA-N |
|---|---|
| Smiles | O=CC12CCC(C(=C)C)C2C3CCC4C5(C)CCC(OC(=O)C=CC6=CC=C(O)C(O)=C6)C(C)(C)C5CCC4(C)C3(C)CC1 |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P18031 | PTPN1 | Protein-tyrosine phosphatase 1B | T16347 | SEA |
| P17706 | PTPN2 | T-cell protein-tyrosine phosphatase | T49156 | SEA |
| Q8TDU6 | GPBAR1 | G-protein coupled bile acid receptor 1 | T86273 | SEA |
| P16885 | PLCG2 | Phospholipase C-gamma-2 | T93922 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T16347 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P18031 | PTPN1 |
| T16347 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P18031 | PTPN1 |
| T16347 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | P18031 | PTPN1 |
| T16347 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P18031 | PTPN1 |
| T49156 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P17706 | PTPN2 |
| T86273 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | Q8TDU6 | GPBAR1 |