Compound details
Aquilegioside C
| Compound ID | CDAMM01693 |
|---|---|
| Common name | Aquilegioside C | IUPAC name | 1-[17-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-9-methoxy-4,6,11,16,16-pentamethyl-8-oxahexacyclo[10.9.0.01,20.04,11.05,9.015,20]henicosan-7-yl]-3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutan-2-one |
| Molecular formula | C49H80O20 |
| Retention time | 4.54 |
|---|---|
| Adduct | [M+2H]2+ |
| Actual mz | 495.272 | Theoretical mz | 495.269 |
| Error | 4.49 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.8636 |
| Inchi key | YBGCHKJKBSHMQJ-FZDLASAMNA-N |
|---|---|
| Smiles | O=C(CC1OC2(OC)CC3(C)C4CCC5C(C)(C)C(OC6OC(CO)C(O)C(O)C6OC7OC(CO)C(O)C(O)C7O)CCC85CC48CCC3(C)C2C1C)C(C)COC9OC(CO)C(O)C(O)C9O |
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T20761 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P15692 | VEGFA |
| T20761 | DI0365 | Retinopathy | [ICD-11: 9B71] | P15692 | VEGFA |
| T20761 | DI0430 | Vascular system developmental anomaly | [ICD-11: LA90] | P15692 | VEGFA |
| T18639 | DI0081 | Chronic arterial occlusive disease | [ICD-11: BD4Z] | P05230 | FGF1 |
| T18639 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P05230 | FGF1 |
| T31621 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P09038 | FGF2 |