Compound details
Uvaol 3-caffeate
| Compound ID | CDAMM01581 |
|---|---|
| Common name | Uvaol 3-caffeate | IUPAC name | [8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picen-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Molecular formula | C39H56O5 |
| Retention time | 15.16 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 605.417 | Theoretical mz | 605.42 |
| Error | 5.58 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.6819 |
| Inchi key | VAVKRHSGFFQRKW-JHJDDYLHNA-N |
|---|---|
| Smiles | O=C(OC1CCC2(C)C(CCC3(C)C2CC=C4C5C(C)C(C)CCC5(CO)CCC43C)C1(C)C)C=CC6=CC=C(O)C(O)=C6 |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P29350 | PTPN6 | Protein-tyrosine phosphatase 1C | T98264 | SEA |
| P18031 | PTPN1 | Protein-tyrosine phosphatase 1B | T16347 | SEA |
| P17706 | PTPN2 | T-cell protein-tyrosine phosphatase | T49156 | SEA |
| P06746 | POLB | DNA polymerase beta (by homology) | T06958 | SEA |
| P13726 | F3 | Coagulation factor VII/tissue factor | T72702 | SEA |
| P25101 | EDNRA | Endothelin receptor ET-A | T23499 | SwissTargetPrediction |
| Q13526 | PIN1 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | T16308 | SEA |
| P16885 | PLCG2 | Phospholipase C-gamma-2 | T93922 | SEA |
| Q01064 | PDE1B | Phosphodiesterase 1B | T77613 | SEA |
| P01100 | FOS | Proto-oncogene c-Fos | T28025 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T16347 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P18031 | PTPN1 |
| T16347 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P18031 | PTPN1 |
| T16347 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | P18031 | PTPN1 |
| T16347 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P18031 | PTPN1 |
| T49156 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P17706 | PTPN2 |
| T06958 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P06746 | POLB |
| T72702 | DI0075 | Cervical cancer | [ICD-11: 2C77] | P13726 | F3 |
| T23499 | DI0070 | Cardiovascular disease | [ICD-11: BA00-BE2Z] | P25101 | EDNRA |
| T23499 | DI0356 | Pulmonary hypertension | [ICD-11: BB01] | P25101 | EDNRA |
| T23499 | DI0425 | Urinary system clinical symptom | [ICD-11: MF8Y] | P25101 | EDNRA |
| T16308 | DI0238 | Lung cancer | [ICD-11: 2C25] | Q13526 | PIN1 |
| T77613 | DI0265 | Mild neurocognitive disorder | [ICD-11: 6D71] | Q01064 | PDE1B |