Compound details
(2S)-2-[[2-(2-ketoindolin-3-yl)acetyl]amino]succinate
| Compound ID | CDAMM01548 |
|---|---|
| Common name | (2S)-2-[[2-(2-ketoindolin-3-yl)acetyl]amino]succinate | IUPAC name | 2-[[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]amino]butanedioate |
| Molecular formula | C14H12N2O6 |
| Retention time | 9.34 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 305.081 | Theoretical mz | 305.077 |
| Error | 13.19 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.2109 |
| Inchi key | SDOOMIWSQMGJCL-HTLJXXAVSA-L |
|---|---|
| Smiles | O=C([O-])CC(NC(=O)CC1C(=O)NC=2C=CC=CC21)C(=O)[O-] |
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P06241 | FYN | Tyrosine-protein kinase FYN | T17980 | SwissTargetPrediction |
| P29274 | ADORA2A | Adenosine A2a receptor | T77365 | SwissTargetPrediction |
| P16083 | NQO2 | Quinone reductase 2 | T75498 | SwissTargetPrediction |
| P08473 | MME | Neprilysin | T05409 | SwissTargetPrediction |
| P15121 | AKR1B1 | Aldose reductase | T26623 | SwissTargetPrediction |
| O15229 | KMO | Kynurenine 3-monooxygenase | T50973 | SwissTargetPrediction |
| P18031 | PTPN1 | Protein-tyrosine phosphatase 1B | T16347 | SwissTargetPrediction |
| P09467 | FBP1 | Fructose-1,6-bisphosphatase | T83391 | SwissTargetPrediction |
| P41143 | OPRD1 | Delta opioid receptor | T58992 | SwissTargetPrediction |
| P49841 | GSK3B | Glycogen synthase kinase-3 beta | T70977 | SwissTargetPrediction |
| P30307 | CDC25C | Dual specificity phosphatase Cdc25C | T40569 | SwissTargetPrediction |
| P23109 | AMPD1 | AMP deaminase 1 | T84553 | SwissTargetPrediction |
| P41146 | OPRL1 | Nociceptin receptor | T52921 | SwissTargetPrediction |
| Q86YT5 | SLC13A5 | Solute carrier family 13 member 5 | T81547 | SwissTargetPrediction |
| Q9Y3Q0 | NAALAD2 | NAALADase II | T70036 | SwissTargetPrediction |
| P53582 | METAP1 | Methionine aminopeptidase 1 | T42337 | SwissTargetPrediction |
| P10144 | GZMB | Granzyme B | T08298 | SwissTargetPrediction |
| P04632 | CAPNS1 | HUMAN calpain-1 or calpain small subunit 1 heterodimer | T00099 | SEA |
| P01589 | IL2RA | Interleukin 2 receptor alpha | T03313 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T17980 | DI0286 | Myeloproliferative neoplasm | [ICD-11: 2A20] | P06241 | FYN |
| T77365 | DI0319 | Orthostatic hypotension | [ICD-11: BA21] | P29274 | ADORA2A |
| T77365 | DI0331 | Parkinsonism | [ICD-11: 8A00] | P29274 | ADORA2A |
| T77365 | DI0359 | Radionuclide imaging | [ICD-11: N.A.] | P29274 | ADORA2A |
| T75498 | DI0214 | Insomnia | [ICD-11: 7A00-7A0Z] | P16083 | NQO2 |
| T05409 | DI0175 | Heart failure | [ICD-11: BD10-BD1Z] | P08473 | MME |
| T26623 | DI0298 | Neuropathy | [ICD-11: 8C0Z] | P15121 | AKR1B1 |
| T26623 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P15121 | AKR1B1 |
| T16347 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P18031 | PTPN1 |
| T16347 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P18031 | PTPN1 |
| T16347 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | P18031 | PTPN1 |
| T16347 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P18031 | PTPN1 |
| T83391 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P09467 | FBP1 |
| T58992 | DI0059 | Bowel habit change | [ICD-11: ME05] | P41143 | OPRD1 |
| T58992 | DI0218 | Irritable bowel syndrome | [ICD-11: DD91] | P41143 | OPRD1 |
| T58992 | DI0324 | Pain | [ICD-11: MG30-MG3Z] | P41143 | OPRD1 |
| T70977 | DI0288 | Myotonic disorder | [ICD-11: 8C71] | P49841 | GSK3B |
| T52921 | DI0039 | Atopic eczema | [ICD-11: EA80] | P41146 | OPRL1 |
| T52921 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | P41146 | OPRL1 |
| T52921 | DI0173 | Headache | [ICD-11: 8A80-8A84] | P41146 | OPRL1 |
| T52921 | DI0175 | Heart failure | [ICD-11: BD10-BD1Z] | P41146 | OPRL1 |
| T08298 | DI0029 | Aneurysm/dissection | [ICD-11: BD50] | P10144 | GZMB |
| T00099 | DI0106 | COVID-19 | [ICD-11: 1D6Y] | P04632 | CAPNS1 |
| T03313 | DI0413 | Transplant rejection | [ICD-11: NE84] | P01589 | IL2RA |