Compound details
2\'\'\'\',2\'\'\'\'\',2\'\'\'\'\'\'-Trihydroxy-5\'\'\',3\'\'\'\',5\'\'\'\'\'-tribenzylisodiuvaretin
| Compound ID | CDAMM01482 |
|---|---|
| Common name | 2\'\'\'\',2\'\'\'\'\',2\'\'\'\'\'\'-Trihydroxy-5\'\'\',3\'\'\'\',5\'\'\'\'\'-tribenzylisodiuvaretin | IUPAC name | 1-[2,4-dihydroxy-3-[[2-hydroxy-5-[[2-hydroxy-3-[[2-hydroxy-5-[(2-hydroxyphenyl)methyl]phenyl]methyl]phenyl]methyl]phenyl]methyl]-5-[(2-hydroxyphenyl)methyl]-6-methoxyphenyl]-3-phenylpropan-1-one |
| Molecular formula | C51H46O9 |
| Retention time | 5.01 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 803.318 | Theoretical mz | 803.321 |
| Error | 3.95 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.3534 |
| Inchi key | IBHMSNPAJLLIPD-UHFFFAOYSA-N |
|---|---|
| Smiles | O=C(C=1C(O)=C(C(O)=C(C1OC)CC=2C=CC=CC2O)CC3=CC(=CC=C3O)CC4=CC=CC(=C4O)CC5=CC(=CC=C5O)CC=6C=CC=CC6O)CCC=7C=CC=CC7 |
| Superclass | Phenylpropanoids and polyketides |
| Class | Diarylheptanoids |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P23141 | CES1 | Acyl coenzyme A:cholesterol acyltransferase | T76369 | SEA |
| O00519 | FAAH | Anandamide amidohydrolase | T11754 | SEA |
| Q01650 | SLC7A5 | L-type amino acid transporter 1 (by homology) | T48330 | SEA |
| O14842 | FFAR1 | Free fatty acid receptor 1 | T25608 | SEA |
| P07195 | LDHB | L-lactate dehydrogenase B chain | T88057 | SEA |
| P47712 | PLA2G4A | Cytosolic phospholipase A2 | T14834 | SEA |
| Q92633 | LPAR1 | Lysophosphatidic acid receptor Edg-2 | T92640 | SEA |
| P24593 | IGFBP5 | Insulin-like growth factor binding protein 5 | T17008 | SEA |
| Q14721 | KCNB1 | Potassium voltage-gated channel subfamily B member 1 | T44516 | SEA |
| Q9P0U3 | SENP1 | Sentrin-specific protease 1 | T96435 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T76369 | DI0335 | Peroxisomal disease | [ICD-11: 5C57] | P23141 | CES1 |
| T76369 | DI0398 | Synthesis disorder | [ICD-11: 5C52-5C59] | P23141 | CES1 |
| T11754 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | O00519 | FAAH |
| T25608 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | O14842 | FFAR1 |
| T14834 | DI0039 | Atopic eczema | [ICD-11: EA80] | P47712 | PLA2G4A |
| T92640 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q92633 | LPAR1 |
| T92640 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q92633 | LPAR1 |
| T92640 | DI0351 | Psoriasis | [ICD-11: EA90] | Q92633 | LPAR1 |
| T92640 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q92633 | LPAR1 |