Compound details
Prephytoene diphosphate
| Compound ID | CDAMM01360 |
|---|---|
| Common name | Prephytoene diphosphate | IUPAC name | [2-methyl-3-(2,6,10,14-tetramethylpentadeca-1,5,9,13-tetraenyl)-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)cyclopropyl]methyl phosphono hydrogen phosphate |
| Molecular formula | C40H68O7P2 |
| Retention time | 14.46 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 723.458 | Theoretical mz | 723.451 |
| Error | 9.71 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 7.4744 |
| Inchi key | RVCNKTPCHZNAAO-UZDKSQMHSA-N |
|---|---|
| Smiles | O=P(O)(O)OP(=O)(O)OCC1C(C=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C1(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P48449 | LSS | Lanosterol synthase | T56175 | SEA |
| Q14534 | SQLE | Squalene monooxygenase (by homology) | T93344 | SEA |
| P49356 | FNTB | Farnesyl protein transferase | T13127 | SEA |
| P49356 | FNTB | Farnesyl protein transferase | T13127 | SEA |
| O95749 | GGPS1 | Geranyltranstransferase | T86528 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T56175 | DI0035 | Arterial occlusive disease | [ICD-11: BD40] | P48449 | LSS |
| T93344 | DI0118 | Dermatophytosis | [ICD-11: 1F28] | Q14534 | SQLE |
| T93344 | DI0385 | Skin fungal infection disorder | [ICD-11: EA60] | Q14534 | SQLE |
| T13127 | DI0342 | Premature ageing appearance | [ICD-11: LD2B] | P49356 | FNTB |
| T13127 | DI0342 | Premature ageing appearance | [ICD-11: LD2B] | P49356 | FNTB |
| T86528 | DI0057 | Bone paget disease | [ICD-11: FB85] | O95749 | GGPS1 |
| T86528 | DI0237 | Low bone mass disorder | [ICD-11: FB83] | O95749 | GGPS1 |
| T86528 | DI0267 | Mineral excesses | [ICD-11: 5B91] | O95749 | GGPS1 |
| T86528 | DI0281 | Musculoskeletal disorder | [ICD-11: FA00-FC0Z] | O95749 | GGPS1 |