Compound details
PS(18:1(9Z)/14:1(9Z))
| Compound ID | CDAMM01137 |
|---|---|
| Common name | PS(18:1(9Z)/14:1(9Z)) | IUPAC name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(Z)-octadec-9-enoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| Molecular formula | C38H70NO10P |
| Retention time | 14.31 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 732.477 | Theoretical mz | 732.481 |
| Error | 4.79 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.814 |
| Inchi key | GKXJCTQSLVKTAV-NTEBNZJHSA-N |
|---|---|
| Smiles | O=C(OCC(OC(=O)CCCCCCCC=CCCCC)COP(=O)(O)OCC(N)C(=O)O)CCCCCCCC=CCCCCCCCC |
| Superclass | Lipids and lipid-like molecules |
| Class | Glycerophospholipids |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P17612 | PRKACA | cAMP-dependent protein kinase alpha-catalytic subunit | T12808 | SEA |
| P34913 | EPHX2 | Epoxide hydratase | T35734 | SEA |
| P39086 | GRIK1 | Glutamate receptor ionotropic kainate 1 | T73495 | SEA |
| O00519 | FAAH | Anandamide amidohydrolase | T11754 | SEA |
| O00206 | TLR4 | Toll-like receptor 4 (by homology) | T81443 | SEA |
| P08263 | GSTA1 | Glutathione S-transferase A1 | T17221 | SEA |
| P15692 | VEGFA | Vascular endothelial growth factor A | T20761 | SEA |
| Q8TDS5 | OXER1 | Oxoeicosanoid receptor 1 | T68834 | SEA |
| P16109 | SELP | P-selectin | T10965 | SEA |
| Q9Y4D2 | DAGLA | Sn1-specific diacylglycerol lipase alpha | T03150 | SEA |
| Q9H228 | S1PR5 | Sphingosine 1-phosphate receptor Edg-8 | T50089 | SEA |
| Q13822 | ENPP2 | Autotaxin | T63512 | SEA |
| Q9HBW0 | LPAR2 | Lysophosphatidic acid receptor Edg-4 | T39380 | SEA |
| Q99500 | S1PR3 | Sphingosine 1-phosphate receptor Edg-3 | T11241 | SEA |
| P43657 | LPAR6 | Lysophosphatidic acid receptor 6 | T13484 | SEA |
| Q9H1C0 | LPAR5 | Lysophosphatidic acid receptor 5 | T18616 | SEA |
| O95136 | S1PR2 | Sphingosine 1-phosphate receptor Edg-5 | T47888 | SEA |
| O95977 | S1PR4 | Sphingosine 1-phosphate receptor Edg-6 | T17523 | SEA |
| O60906 | SMPD2 | Neutral sphingomyelinase | T57316 | SEA |
| Q9UPC5 | GPR34 | Probable G-protein coupled receptor 34 | T73859 | SwissTargetPrediction and SEA |
| O00398 | P2RY10 | Putative P2Y purinoceptor 10 | T00488 | SwissTargetPrediction and SEA |
| Q9BXC1 | GPR174 | Probable G-protein coupled receptor 174 | T87661 | SwissTargetPrediction and SEA |
| Q9UBY5 | LPAR3 | Lysophosphatidic acid receptor Edg-7 | T95923 | SEA |
| Q92633 | LPAR1 | Lysophosphatidic acid receptor Edg-2 | T92640 | SEA |
| P16885 | PLCG2 | Phospholipase C-gamma-2 | T93922 | SEA |
| Q99677 | LPAR4 | Lysophosphatidic acid receptor 4 | T58130 | SEA |
| O60603 | TLR2 | Toll-like receptor 2 | T82078 | SEA |
| Q92887 | CMOAT | Multidrug resistance-associated protein 2 | T61792 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T12808 | DI0279 | Muscular atrophy | [ICD-11: 8B61] | P17612 | PRKACA |
| T35734 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P34913 | EPHX2 |
| T35734 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | P34913 | EPHX2 |
| T73495 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | P39086 | GRIK1 |
| T73495 | DI0396 | Substance abuse | [ICD-11: 6C40] | P39086 | GRIK1 |
| T11754 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | O00519 | FAAH |
| T81443 | DI0022 | Allergic/hypersensitivity disorder | [ICD-11: 4A80-4A8Z] | O00206 | TLR4 |
| T81443 | DI0346 | Prostate cancer | [ICD-11: 2C82] | O00206 | TLR4 |
| T81443 | DI0375 | Sepsis | [ICD-11: 1G40-1G41] | O00206 | TLR4 |
| T20761 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P15692 | VEGFA |
| T20761 | DI0365 | Retinopathy | [ICD-11: 9B71] | P15692 | VEGFA |
| T20761 | DI0430 | Vascular system developmental anomaly | [ICD-11: LA90] | P15692 | VEGFA |
| T10965 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P16109 | SELP |
| T10965 | DI0381 | Sickle-cell disorder | [ICD-11: 3A51] | P16109 | SELP |
| T50089 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | Q9H228 | S1PR5 |
| T63512 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q13822 | ENPP2 |
| T11241 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | Q99500 | S1PR3 |
| T47888 | DI0419 | Ulcerative colitis | [ICD-11: DD71] | O95136 | S1PR2 |
| T95923 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q9UBY5 | LPAR3 |
| T95923 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q9UBY5 | LPAR3 |
| T92640 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q92633 | LPAR1 |
| T92640 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q92633 | LPAR1 |
| T92640 | DI0351 | Psoriasis | [ICD-11: EA90] | Q92633 | LPAR1 |
| T92640 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q92633 | LPAR1 |
| T82078 | DI0346 | Prostate cancer | [ICD-11: 2C82] | O60603 | TLR2 |