Compound details
Sativic acid
| Compound ID | CDAMM00995 |
|---|---|
| Common name | Sativic acid | IUPAC name | 9,10,12,13-tetrahydroxyoctadecanoic acid |
| Molecular formula | C18H36O6 |
| Retention time | 12.25 |
|---|---|
| Adduct | [M+Na]+ |
| Actual mz | 371.24 | Theoretical mz | 371.24 |
| Error | 0.59 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.4643 |
| Inchi key | VJOGZGLNDROOFS-UHFFFAOYNA-N |
|---|---|
| Smiles | O=C(O)CCCCCCCC(O)C(O)CC(O)C(O)CCCCC |
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P36544 | CHRNA7 | Neuronal acetylcholine receptor protein alpha-7 subunit | T34429 | SwissTargetPrediction |
| P07327 | ADH1A | Alcohol dehydrogenase alpha chain | T65570 | SEA |
| P04818 | TYMS | Thymidylate synthase (by homology) | T98397 | SwissTargetPrediction |
| P47869 | GABRA2 | GABA A receptor alpha-2/beta-2/gamma-2 | T51452 | SwissTargetPrediction |
| O75899 | GABBR2 | GABA-B receptor | T42446 | SEA |
| P48066 | SLC6A11 | GABA transporter 3 | T38200 | SEA |
| O75899 | GABBR2 | GABA-B receptor | T42446 | SwissTargetPrediction and SEA |
| P06239 | LCK | Tyrosine-protein kinase LCK | T12499 | SwissTargetPrediction |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 (by homology) | T70680 | SwissTargetPrediction and SEA |
| P14555 | PLA2G2A | Phospholipase A2 group IIA | T19160 | SEA |
| P08514 | ITGA2B | Integrin alpha-IIb/beta-3 | T50688 | SwissTargetPrediction |
| Q96RI1 | NR1H4 | Bile acid receptor FXR | T51426 | SwissTargetPrediction |
| P78352 | DLG4 | Disks large homolog 4 | T04507 | SwissTargetPrediction |
| P34913 | EPHX2 | Epoxide hydratase | T35734 | SEA |
| P39086 | GRIK1 | Glutamate receptor ionotropic kainate 1 | T73495 | SEA |
| Q9H3R0 | KDM4C | Lysine-specific demethylase 4C | T73863 | SEA |
| P23141 | CES1 | Acyl coenzyme A:cholesterol acyltransferase | T76369 | SEA |
| O75164 | KDM4A | Lysine-specific demethylase 4A | T18904 | SEA |
| P10275 | AR | Androgen Receptor | T11211 | SwissTargetPrediction |
| O00519 | FAAH | Anandamide amidohydrolase | T11754 | SEA |
| P08185 | SERPINA6 | Corticosteroid binding globulin | T88452 | SwissTargetPrediction |
| P11511 | CYP19A1 | Cytochrome P450 19A1 | T13260 | SwissTargetPrediction |
| Q07075 | ENPEP | Aminopeptidase A | T31956 | SEA |
| P15090 | FABP4 | Fatty acid binding protein adipocyte | T07217 | SwissTargetPrediction |
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | T86591 | SwissTargetPrediction and SEA |
| Q01469 | FABP5 | Fatty acid binding protein epidermal | T21507 | SwissTargetPrediction |
| Q03181 | PPARD | Peroxisome proliferator-activated receptor delta | T36557 | SwissTargetPrediction |
| O14842 | FFAR1 | Free fatty acid receptor 1 | T25608 | SwissTargetPrediction |
| P30307 | CDC25C | Dual specificity phosphatase Cdc25C | T40569 | SwissTargetPrediction and SEA |
| P28845 | HSD11B1 | 11-beta-hydroxysteroid dehydrogenase 1 | T65200 | SwissTargetPrediction |
| P11473 | VDR | Vitamin D receptor | T34234 | SwissTargetPrediction |
| Q8TDU6 | GPBAR1 | G-protein coupled bile acid receptor 1 | T86273 | SwissTargetPrediction |
| P06746 | POLB | DNA polymerase beta (by homology) | T06958 | SwissTargetPrediction and SEA |
| P22894 | MMP8 | Matrix metalloproteinase 8 | T08856 | SwissTargetPrediction |
| P08254 | MMP3 | Matrix metalloproteinase 3 | T86702 | SwissTargetPrediction |
| P14780 | MMP9 | Matrix metalloproteinase 9 | T54156 | SwissTargetPrediction |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | T62815 | SwissTargetPrediction |
| P21731 | TBXA2R | Thromboxane A2 receptor | T76198 | SEA |
| P35372 | OPRM1 | Mu opioid receptor | T47768 | SwissTargetPrediction |
| P62993 | GRB2 | Growth factor receptor-bound protein 2 | T30926 | SwissTargetPrediction |
| Q16539 | MAPK14 | MAP kinase p38 alpha | T65864 | SwissTargetPrediction |
| O14965 | AURKA | Serine/threonine-protein kinase Aurora-A | T87675 | SwissTargetPrediction |
| P41143 | OPRD1 | Delta opioid receptor | T58992 | SwissTargetPrediction |
| P37231 | PPARG | Peroxisome proliferator-activated receptor gamma | T58921 | SEA |
| P43116 | PTGER2 | Prostanoid EP2 receptor | T38529 | SwissTargetPrediction and SEA |
| P04035 | HMGCR | HMG-CoA reductase | T53585 | SwissTargetPrediction and SEA |
| P11413 | G6PD | Glucose-6-phosphate 1-dehydrogenase | T63484 | SwissTargetPrediction |
| Q15722 | LTB4R | Leukotriene B4 receptor 1 | T59626 | SEA |
| P11387 | TOP1 | DNA topoisomerase I | T09826 | SwissTargetPrediction |
| Q9UHL4 | DPP7 | Dipeptidyl peptidase II | T50773 | SwissTargetPrediction |
| P49841 | GSK3B | Glycogen synthase kinase-3 beta | T70977 | SwissTargetPrediction |
| P41229 | KDM5C | Lysine-specific demethylase 5C | T85540 | SwissTargetPrediction |
| P53779 | MAPK10 | c-Jun N-terminal kinase 3 | T85421 | SwissTargetPrediction |
| P12931 | SRC | Tyrosine-protein kinase SRC | T85943 | SwissTargetPrediction |
| P08263 | GSTA1 | Glutathione S-transferase A1 | T17221 | SEA |
| P35408 | PTGER4 | Prostanoid EP4 receptor | T18876 | SwissTargetPrediction and SEA |
| P43115 | PTGER3 | Prostanoid EP3 receptor | T85467 | SEA |
| P0DJD9 | PGA5 | Pepsin A | T17863 | SEA |
| P30307 | CDC25C | Dual specificity phosphatase Cdc25C | T40569 | SEA |
| Q9Y2K7 | KDM2A | Lysine-specific demethylase 2A | T71949 | SwissTargetPrediction |
| P39900 | MMP12 | Matrix metalloproteinase 12 | T03500 | SwissTargetPrediction |
| P49840 | GSK3A | Glycogen synthase kinase-3 alpha | T76910 | SwissTargetPrediction |
| P42574 | CASP3 | Caspase-3 | T57943 | SwissTargetPrediction |
| P24557 | TBXAS1 | Thromboxane-A synthase | T78356 | SwissTargetPrediction |
| Q8TDS5 | OXER1 | Oxoeicosanoid receptor 1 | T68834 | SEA |
| P43088 | PTGFR | Prostanoid FP receptor | T75797 | SwissTargetPrediction and SEA |
| P16109 | SELP | P-selectin | T10965 | SwissTargetPrediction and SEA |
| P14151 | SELL | Leukocyte adhesion molecule-1 | T60526 | SEA |
| O76074 | PDE5A | Phosphodiesterase 5A | T07663 | SwissTargetPrediction |
| P43119 | PTGIR | Prostanoid IP receptor | T99954 | SwissTargetPrediction and SEA |
| P53350 | PLK1 | Serine/threonine-protein kinase PLK1 | T40694 | SwissTargetPrediction |
| Q6ZMT4 | KDM7A | Lysine-specific demethylase 7A/7B | T18784 | SEA |
| P00390 | GSR | Glutathione reductase | T30803 | SEA |
| P35557 | GCK | Hexokinase type IV | T87166 | SwissTargetPrediction |
| P00374 | DHFR | Dihydrofolate reductase | T17345 | SwissTargetPrediction |
| P30307 | CDC25C | Dual specificity phosphatase Cdc25C | T40569 | SEA |
| P40189 | IL6ST | Interleukin-6 receptor subunit beta | T93440 | SEA |
| Q13822 | ENPP2 | Autotaxin | T63512 | SEA |
| Q9HBW0 | LPAR2 | Lysophosphatidic acid receptor Edg-4 | T39380 | SEA |
| P43657 | LPAR6 | Lysophosphatidic acid receptor 6 | T13484 | SEA |
| Q9H1C0 | LPAR5 | Lysophosphatidic acid receptor 5 | T18616 | SEA |
| O95136 | S1PR2 | Sphingosine 1-phosphate receptor Edg-5 | T47888 | SEA |
| P18507 | GABRG2 | GABA-A receptor; alpha-6/beta-3/gamma-2 | T08910 | SwissTargetPrediction |
| O95977 | S1PR4 | Sphingosine 1-phosphate receptor Edg-6 | T17523 | SEA |
| O60906 | SMPD2 | Neutral sphingomyelinase | T57316 | SEA |
| Q9UPC5 | GPR34 | Probable G-protein coupled receptor 34 | T73859 | SEA |
| O00398 | P2RY10 | Putative P2Y purinoceptor 10 | T00488 | SEA |
| Q9BXC1 | GPR174 | Probable G-protein coupled receptor 174 | T87661 | SEA |
| Q9UBY5 | LPAR3 | Lysophosphatidic acid receptor Edg-7 | T95923 | SEA |
| Q92633 | LPAR1 | Lysophosphatidic acid receptor Edg-2 | T92640 | SEA |
| Q99677 | LPAR4 | Lysophosphatidic acid receptor 4 | T58130 | SEA |
| Q9UJM8 | HAO1 | Hydroxyacid oxidase 1 | T63170 | SEA |
| O95749 | GGPS1 | Geranyltranstransferase | T86528 | SEA |
| Q04609 | FOLH1 | Glutamate carboxypeptidase II | T97071 | SEA |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 (by homology) | T70680 | SEA |
| Q9UN88 | GABRQ | GABA(A) receptor theta | T15161 | SEA |
| P78329 | CYP4F2 | Cytochrome P450 4f | T82604 | SEA |
| O60603 | TLR2 | Toll-like receptor 2 | T82078 | SEA |
| O95749 | GGPS1 | Geranyltranstransferase | T86528 | SEA |
| P47870 | GABRB2 | GABA(A) receptor beta-2 | T80387 | SwissTargetPrediction |
| Q92959 | SLCO2A1 | Prostaglandin transporter | T15518 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T34429 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | P36544 | CHRNA7 |
| T34429 | DI0370 | Schizophrenia | [ICD-11: 6A20] | P36544 | CHRNA7 |
| T65570 | DI0139 | Exposure to noxious substances harmful effect | [ICD-11: NE61] | P07327 | ADH1A |
| T98397 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P04818 | TYMS |
| T98397 | DI0395 | Stomach cancer | [ICD-11: 2B72] | P04818 | TYMS |
| T51452 | DI0216 | Intentional self-harm | [ICD-11: PC91] | P47869 | GABRA2 |
| T42446 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | O75899 | GABBR2 |
| T42446 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | O75899 | GABBR2 |
| T42446 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | O75899 | GABBR2 |
| T42446 | DI0290 | Narcolepsy | [ICD-11: 7A20] | O75899 | GABBR2 |
| T38200 | DI0207 | Indeterminate colitis | [ICD-11: DD72] | P48066 | SLC6A11 |
| T42446 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | O75899 | GABBR2 |
| T42446 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | O75899 | GABBR2 |
| T42446 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | O75899 | GABBR2 |
| T42446 | DI0290 | Narcolepsy | [ICD-11: 7A20] | O75899 | GABBR2 |
| T12499 | DI0286 | Myeloproliferative neoplasm | [ICD-11: 2A20] | P06239 | LCK |
| T70680 | DI0167 | Gout | [ICD-11: FA25] | Q4U2R8 | SLC22A6 |
| T70680 | DI0206 | Inborn purine/pyrimidine/nucleotide metabolism error | [ICD-11: 5C55] | Q4U2R8 | SLC22A6 |
| T70680 | DI0310 | Ocular disease | [ICD-11: N.A.] | Q4U2R8 | SLC22A6 |
| T19160 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P14555 | PLA2G2A |
| T50688 | DI0007 | Acquired hypermelanosis | [ICD-11: ED60] | P08514 | ITGA2B |
| T50688 | DI0030 | Angina pectoris | [ICD-11: BA40] | P08514 | ITGA2B |
| T50688 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | P08514 | ITGA2B |
| T51426 | DI0043 | Autoimmune liver disease | [ICD-11: DB96] | Q96RI1 | NR1H4 |
| T51426 | DI0077 | Cholelithiasis | [ICD-11: DC11] | Q96RI1 | NR1H4 |
| T51426 | DI0320 | Osteoarthritis | [ICD-11: FA00-FA05] | Q96RI1 | NR1H4 |
| T04507 | DI0073 | Cerebral ischaemia | [ICD-11: 8B1Z] | P78352 | DLG4 |
| T04507 | DI0219 | Ischaemic/haemorrhagic stroke | [ICD-11: 8B20] | P78352 | DLG4 |
| T35734 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P34913 | EPHX2 |
| T35734 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | P34913 | EPHX2 |
| T73495 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | P39086 | GRIK1 |
| T73495 | DI0396 | Substance abuse | [ICD-11: 6C40] | P39086 | GRIK1 |
| T76369 | DI0335 | Peroxisomal disease | [ICD-11: 5C57] | P23141 | CES1 |
| T76369 | DI0398 | Synthesis disorder | [ICD-11: 5C52-5C59] | P23141 | CES1 |
| T11211 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P10275 | AR |
| T11211 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P10275 | AR |
| T11211 | DI0021 | Alcoholic liver disease | [ICD-11: DB94] | P10275 | AR |
| T11211 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P10275 | AR |
| T11211 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P10275 | AR |
| T11211 | DI0145 | Female pelvic pain | [ICD-11: GA34] | P10275 | AR |
| T11211 | DI0194 | Hypo-osmolality/hyponatraemia | [ICD-11: 5C72] | P10275 | AR |
| T11211 | DI0237 | Low bone mass disorder | [ICD-11: FB83] | P10275 | AR |
| T11211 | DI0247 | Mammary tumour | [ICD-11: 2C60-2C6Z] | P10275 | AR |
| T11211 | DI0346 | Prostate cancer | [ICD-11: 2C82] | P10275 | AR |
| T11211 | DI0401 | Testicular dysfunction | [ICD-11: 5A81] | P10275 | AR |
| T11754 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | O00519 | FAAH |
| T88452 | DI0037 | Asthma | [ICD-11: CA23] | P08185 | SERPINA6 |
| T88452 | DI0339 | Postoperative inflammation | [ICD-11: 1A00-CA43] | P08185 | SERPINA6 |
| T88452 | DI0362 | Respiratory system disease | [ICD-11: CB40-CB7Z] | P08185 | SERPINA6 |
| T13260 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P11511 | CYP19A1 |
| T13260 | DI0108 | Cushing syndrome | [ICD-11: 5A70] | P11511 | CYP19A1 |
| T31956 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | Q07075 | ENPEP |
| T86591 | DI0187 | Hyperlipidemia | [ICD-11: 5C80] | Q07869 | PPARA |
| T86591 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | Q07869 | PPARA |
| T86591 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | Q07869 | PPARA |
| T36557 | DI0302 | Non-alcoholic fatty liver disease | [ICD-11: DB92] | Q03181 | PPARD |
| T36557 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | Q03181 | PPARD |
| T25608 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | O14842 | FFAR1 |
| T65200 | DI0210 | Influenza | [ICD-11: 1E30-1E32] | P28845 | HSD11B1 |
| T65200 | DI0239 | Lupus erythematosus | [ICD-11: 4A40] | P28845 | HSD11B1 |
| T65200 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P28845 | HSD11B1 |
| T34234 | DI0083 | Chronic kidney disease | [ICD-11: GB61] | P11473 | VDR |
| T34234 | DI0171 | Hair/hair growth developmental defect | [ICD-11: LC30] | P11473 | VDR |
| T34234 | DI0189 | Hyper-parathyroidism | [ICD-11: 5A51] | P11473 | VDR |
| T34234 | DI0195 | Hypo-parathyroidism | [ICD-11: 5A50] | P11473 | VDR |
| T34234 | DI0266 | Mineral deficiency | [ICD-11: 5B5K] | P11473 | VDR |
| T34234 | DI0351 | Psoriasis | [ICD-11: EA90] | P11473 | VDR |
| T34234 | DI0437 | Vitamin deficiency | [ICD-11: 5B55-5B5F] | P11473 | VDR |
| T86273 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | Q8TDU6 | GPBAR1 |
| T06958 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P06746 | POLB |
| T08856 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P22894 | MMP8 |
| T86702 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | P08254 | MMP3 |
| T86702 | DI0179 | Hepatitis virus infection | [ICD-11: 1E50-1E51] | P08254 | MMP3 |
| T86702 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | P08254 | MMP3 |
| T86702 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P08254 | MMP3 |
| T86702 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | P08254 | MMP3 |
| T86702 | DI0320 | Osteoarthritis | [ICD-11: FA00-FA05] | P08254 | MMP3 |
| T86702 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P08254 | MMP3 |
| T54156 | DI0219 | Ischaemic/haemorrhagic stroke | [ICD-11: 8B20] | P14780 | MMP9 |
| T54156 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P14780 | MMP9 |
| T54156 | DI0395 | Stomach cancer | [ICD-11: 2B72] | P14780 | MMP9 |
| T54156 | DI0419 | Ulcerative colitis | [ICD-11: DD71] | P14780 | MMP9 |
| T76198 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P21731 | TBXA2R |
| T76198 | DI0121 | Diabetic foot ulcer | [ICD-11: BD54] | P21731 | TBXA2R |
| T76198 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | P21731 | TBXA2R |
| T76198 | DI0378 | Sexual dysfunction | [ICD-11: HA00-HA01] | P21731 | TBXA2R |
| T47768 | DI0013 | Acute pain | [ICD-11: MG31] | P35372 | OPRM1 |
| T47768 | DI0059 | Bowel habit change | [ICD-11: ME05] | P35372 | OPRM1 |
| T47768 | DI0087 | Chronic pain | [ICD-11: MG30] | P35372 | OPRM1 |
| T47768 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | P35372 | OPRM1 |
| T47768 | DI0105 | Cough | [ICD-11: MD12] | P35372 | OPRM1 |
| T47768 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | P35372 | OPRM1 |
| T47768 | DI0124 | Digestive system disease | [ICD-11: DE2Z] | P35372 | OPRM1 |
| T47768 | DI0218 | Irritable bowel syndrome | [ICD-11: DD91] | P35372 | OPRM1 |
| T47768 | DI0228 | Large intestine motility disorder | [ICD-11: DB32] | P35372 | OPRM1 |
| T47768 | DI0317 | Opioid use disorder | [ICD-11: 6C43] | P35372 | OPRM1 |
| T47768 | DI0324 | Pain | [ICD-11: MG30-MG3Z] | P35372 | OPRM1 |
| T47768 | DI0349 | Pruritus | [ICD-11: EC90] | P35372 | OPRM1 |
| T47768 | DI0374 | Sensation disturbance | [ICD-11: MB40] | P35372 | OPRM1 |
| T30926 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P62993 | GRB2 |
| T30926 | DI0245 | Malignant haematopoietic neoplasm | [ICD-11: 2B33] | P62993 | GRB2 |
| T30926 | DI0250 | Mature B-cell lymphoma | [ICD-11: 2A85] | P62993 | GRB2 |
| T30926 | DI0284 | Myelodysplastic syndrome | [ICD-11: 2A37] | P62993 | GRB2 |
| T30926 | DI0286 | Myeloproliferative neoplasm | [ICD-11: 2A20] | P62993 | GRB2 |
| T65864 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | Q16539 | MAPK14 |
| T65864 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | Q16539 | MAPK14 |
| T65864 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | Q16539 | MAPK14 |
| T65864 | DI0437 | Vitamin deficiency | [ICD-11: 5B55-5B5F] | Q16539 | MAPK14 |
| T87675 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | O14965 | AURKA |
| T87675 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | O14965 | AURKA |
| T58992 | DI0059 | Bowel habit change | [ICD-11: ME05] | P41143 | OPRD1 |
| T58992 | DI0218 | Irritable bowel syndrome | [ICD-11: DD91] | P41143 | OPRD1 |
| T58992 | DI0324 | Pain | [ICD-11: MG30-MG3Z] | P41143 | OPRD1 |
| T58921 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P37231 | PPARG |
| T58921 | DI0025 | Alzheimer disease | [ICD-11: 8A20] | P37231 | PPARG |
| T58921 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P37231 | PPARG |
| T38529 | DI0003 | Abortion | [ICD-11: JA00] | P43116 | PTGER2 |
| T38529 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P43116 | PTGER2 |
| T38529 | DI0121 | Diabetic foot ulcer | [ICD-11: BD54] | P43116 | PTGER2 |
| T38529 | DI0166 | Glaucoma | [ICD-11: 9C61] | P43116 | PTGER2 |
| T38529 | DI0356 | Pulmonary hypertension | [ICD-11: BB01] | P43116 | PTGER2 |
| T38529 | DI0378 | Sexual dysfunction | [ICD-11: HA00-HA01] | P43116 | PTGER2 |
| T38529 | DI0413 | Transplant rejection | [ICD-11: NE84] | P43116 | PTGER2 |
| T53585 | DI0070 | Cardiovascular disease | [ICD-11: BA00-BE2Z] | P04035 | HMGCR |
| T53585 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P04035 | HMGCR |
| T53585 | DI0128 | Dyslipidemia | [ICD-11: 5C80-5C81] | P04035 | HMGCR |
| T53585 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | P04035 | HMGCR |
| T53585 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P04035 | HMGCR |
| T53585 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | P04035 | HMGCR |
| T53585 | DI0324 | Pain | [ICD-11: MG30-MG3Z] | P04035 | HMGCR |
| T63484 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P11413 | G6PD |
| T59626 | DI0184 | Human immunodeficiency virus disease | [ICD-11: 1C60-1C62] | Q15722 | LTB4R |
| T59626 | DI0355 | Pulmonary disease | [ICD-11: 1B10-1F85] | Q15722 | LTB4R |
| T59626 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | Q15722 | LTB4R |
| T09826 | DI0046 | Bacterial infection | [ICD-11: 1A00-1C4Z] | P11387 | TOP1 |
| T09826 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P11387 | TOP1 |
| T09826 | DI0238 | Lung cancer | [ICD-11: 2C25] | P11387 | TOP1 |
| T09826 | DI0321 | Ovarian cancer | [ICD-11: 2C73] | P11387 | TOP1 |
| T09826 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P11387 | TOP1 |
| T70977 | DI0288 | Myotonic disorder | [ICD-11: 8C71] | P49841 | GSK3B |
| T85421 | DI0125 | Dissociative neurological symptom disorder | [ICD-11: 6B60] | P53779 | MAPK10 |
| T85943 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P12931 | SRC |
| T85943 | DI0220 | Ischemia | [ICD-11: 8B10-8B11] | P12931 | SRC |
| T85943 | DI0286 | Myeloproliferative neoplasm | [ICD-11: 2A20] | P12931 | SRC |
| T85943 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P12931 | SRC |
| T18876 | DI0037 | Asthma | [ICD-11: CA23] | P35408 | PTGER4 |
| T18876 | DI0175 | Heart failure | [ICD-11: BD10-BD1Z] | P35408 | PTGER4 |
| T18876 | DI0264 | Migraine | [ICD-11: 8A80] | P35408 | PTGER4 |
| T18876 | DI0303 | Non-small-cell lung cancer | [ICD-11: 2C25] | P35408 | PTGER4 |
| T18876 | DI0324 | Pain | [ICD-11: MG30-MG3Z] | P35408 | PTGER4 |
| T18876 | DI0360 | Rectum cancer | [ICD-11: 2B92] | P35408 | PTGER4 |
| T18876 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P35408 | PTGER4 |
| T18876 | DI0414 | Transplanted organ/tissue | [ICD-11: QB63] | P35408 | PTGER4 |
| T85467 | DI0166 | Glaucoma | [ICD-11: 9C61] | P43115 | PTGER3 |
| T85467 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P43115 | PTGER3 |
| T85467 | DI0414 | Transplanted organ/tissue | [ICD-11: QB63] | P43115 | PTGER3 |
| T03500 | DI0037 | Asthma | [ICD-11: CA23] | P39900 | MMP12 |
| T03500 | DI0238 | Lung cancer | [ICD-11: 2C25] | P39900 | MMP12 |
| T03500 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P39900 | MMP12 |
| T76910 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | P49840 | GSK3A |
| T57943 | DI0060 | Brain cancer | [ICD-11: 2A00] | P42574 | CASP3 |
| T78356 | DI0030 | Angina pectoris | [ICD-11: BA40] | P24557 | TBXAS1 |
| T75797 | DI0003 | Abortion | [ICD-11: JA00] | P43088 | PTGFR |
| T75797 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P43088 | PTGFR |
| T75797 | DI0166 | Glaucoma | [ICD-11: 9C61] | P43088 | PTGFR |
| T10965 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P16109 | SELP |
| T10965 | DI0381 | Sickle-cell disorder | [ICD-11: 3A51] | P16109 | SELP |
| T60526 | DI0037 | Asthma | [ICD-11: CA23] | P14151 | SELL |
| T60526 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P14151 | SELL |
| T07663 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | O76074 | PDE5A |
| T07663 | DI0213 | Innate/adaptive immunodeficiency | [ICD-11: 4A00] | O76074 | PDE5A |
| T07663 | DI0378 | Sexual dysfunction | [ICD-11: HA00-HA01] | O76074 | PDE5A |
| T07663 | DI0411 | Tonus and reflex abnormality | [ICD-11: MB47] | O76074 | PDE5A |
| T99954 | DI0003 | Abortion | [ICD-11: JA00] | P43119 | PTGIR |
| T99954 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P43119 | PTGIR |
| T99954 | DI0356 | Pulmonary hypertension | [ICD-11: BB01] | P43119 | PTGIR |
| T40694 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P53350 | PLK1 |
| T40694 | DI0284 | Myelodysplastic syndrome | [ICD-11: 2A37] | P53350 | PLK1 |
| T40694 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P53350 | PLK1 |
| T30803 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P00390 | GSR |
| T87166 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P35557 | GCK |
| T87166 | DI0120 | Diabetes mellitus | [ICD-11: 5A10] | P35557 | GCK |
| T87166 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | P35557 | GCK |
| T87166 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P35557 | GCK |
| T17345 | DI0207 | Indeterminate colitis | [ICD-11: DD72] | P00374 | DHFR |
| T17345 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P00374 | DHFR |
| T17345 | DI0416 | Tuberculosis | [ICD-11: 1B10-1B12] | P00374 | DHFR |
| T17345 | DI0427 | Urinary tract infection | [ICD-11: GC08] | P00374 | DHFR |
| T93440 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P40189 | IL6ST |
| T63512 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q13822 | ENPP2 |
| T47888 | DI0419 | Ulcerative colitis | [ICD-11: DD71] | O95136 | S1PR2 |
| T08910 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | P18507 | GABRG2 |
| T08910 | DI0256 | Mental/behavioural/neurodevelopmental disorder | [ICD-11: 6E20-6E8Z] | P18507 | GABRG2 |
| T08910 | DI0411 | Tonus and reflex abnormality | [ICD-11: MB47] | P18507 | GABRG2 |
| T95923 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q9UBY5 | LPAR3 |
| T95923 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q9UBY5 | LPAR3 |
| T92640 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q92633 | LPAR1 |
| T92640 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q92633 | LPAR1 |
| T92640 | DI0351 | Psoriasis | [ICD-11: EA90] | Q92633 | LPAR1 |
| T92640 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q92633 | LPAR1 |
| T63170 | DI0201 | Inborn carbohydrate metabolism error | [ICD-11: 5C51] | Q9UJM8 | HAO1 |
| T86528 | DI0057 | Bone paget disease | [ICD-11: FB85] | O95749 | GGPS1 |
| T86528 | DI0237 | Low bone mass disorder | [ICD-11: FB83] | O95749 | GGPS1 |
| T86528 | DI0267 | Mineral excesses | [ICD-11: 5B91] | O95749 | GGPS1 |
| T86528 | DI0281 | Musculoskeletal disorder | [ICD-11: FA00-FC0Z] | O95749 | GGPS1 |
| T97071 | DI0122 | Diagnostic imaging | [ICD-11: N.A.] | Q04609 | FOLH1 |
| T97071 | DI0346 | Prostate cancer | [ICD-11: 2C82] | Q04609 | FOLH1 |
| T70680 | DI0167 | Gout | [ICD-11: FA25] | Q4U2R8 | SLC22A6 |
| T70680 | DI0206 | Inborn purine/pyrimidine/nucleotide metabolism error | [ICD-11: 5C55] | Q4U2R8 | SLC22A6 |
| T70680 | DI0310 | Ocular disease | [ICD-11: N.A.] | Q4U2R8 | SLC22A6 |
| T82078 | DI0346 | Prostate cancer | [ICD-11: 2C82] | O60603 | TLR2 |
| T86528 | DI0057 | Bone paget disease | [ICD-11: FB85] | O95749 | GGPS1 |
| T86528 | DI0237 | Low bone mass disorder | [ICD-11: FB83] | O95749 | GGPS1 |
| T86528 | DI0267 | Mineral excesses | [ICD-11: 5B91] | O95749 | GGPS1 |
| T86528 | DI0281 | Musculoskeletal disorder | [ICD-11: FA00-FC0Z] | O95749 | GGPS1 |
| T80387 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | P47870 | GABRB2 |
| T80387 | DI0214 | Insomnia | [ICD-11: 7A00-7A0Z] | P47870 | GABRB2 |
| T80387 | DI0256 | Mental/behavioural/neurodevelopmental disorder | [ICD-11: 6E20-6E8Z] | P47870 | GABRB2 |
| T80387 | DI0411 | Tonus and reflex abnormality | [ICD-11: MB47] | P47870 | GABRB2 |