Compound details
(9S,10S)-9,10-dihydroxyoctadecanoate
| Compound ID | CDAMM00588 |
|---|---|
| Common name | (9S,10S)-9,10-dihydroxyoctadecanoate | IUPAC name | 9,10-dihydroxyoctadecanoic acid |
| Molecular formula | C18H36O4 |
| Retention time | 13.5 |
|---|---|
| Adduct | [M+Na]+ |
| Actual mz | 339.246 | Theoretical mz | 339.25 |
| Error | 11.55 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 6.4586 |
| Inchi key | VACHUYIREGFMSP-RXQGYGPJNA-N |
|---|---|
| Smiles | O=C(O)CCCCCCCC(O)C(O)CCCCCCCC |
| Superclass | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P36544 | CHRNA7 | Neuronal acetylcholine receptor protein alpha-7 subunit | T34429 | SwissTargetPrediction |
| P30542 | ADORA1 | Adenosine A1 receptor | T92072 | SwissTargetPrediction |
| P07327 | ADH1A | Alcohol dehydrogenase alpha chain | T65570 | SEA |
| P47869 | GABRA2 | GABA A receptor alpha-2/beta-2/gamma-2 | T51452 | SwissTargetPrediction |
| P24046 | GABRR1 | GABA receptor rho-1 subunit | T99665 | SEA |
| O75899 | GABBR2 | GABA-B receptor | T42446 | SEA |
| P09960 | LTA4H | Leukotriene A4 hydrolase | T03691 | SwissTargetPrediction |
| P48066 | SLC6A11 | GABA transporter 3 | T38200 | SEA |
| O75899 | GABBR2 | GABA-B receptor | T42446 | SwissTargetPrediction and SEA |
| P00915 | CA1 | Carbonic anhydrase I | T13201 | SwissTargetPrediction |
| P42336 | PIK3CA | PI3-kinase p110-alpha subunit | T80276 | SwissTargetPrediction |
| P00918 | CA2 | Carbonic anhydrase II | T20401 | SwissTargetPrediction |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 (by homology) | T70680 | SwissTargetPrediction and SEA |
| P14555 | PLA2G2A | Phospholipase A2 group IIA | T19160 | SEA |
| Q96RI1 | NR1H4 | Bile acid receptor FXR | T51426 | SwissTargetPrediction |
| P34913 | EPHX2 | Epoxide hydratase | T35734 | SwissTargetPrediction and SEA |
| Q9H3R0 | KDM4C | Lysine-specific demethylase 4C | T73863 | SEA |
| P23141 | CES1 | Acyl coenzyme A:cholesterol acyltransferase | T76369 | SEA |
| O75164 | KDM4A | Lysine-specific demethylase 4A | T18904 | SEA |
| P10275 | AR | Androgen Receptor | T11211 | SwissTargetPrediction |
| O00519 | FAAH | Anandamide amidohydrolase | T11754 | SEA |
| P04150 | NR3C1 | Glucocorticoid receptor | T40016 | SwissTargetPrediction |
| P06401 | PGR | Progesterone receptor | T22939 | SwissTargetPrediction |
| P08185 | SERPINA6 | Corticosteroid binding globulin | T88452 | SwissTargetPrediction |
| P11511 | CYP19A1 | Cytochrome P450 19A1 | T13260 | SwissTargetPrediction |
| P51681 | CCR5 | C-C chemokine receptor type 5 | T09960 | SwissTargetPrediction |
| Q9UHC9 | NPC1L1 | Niemann-Pick C1-like protein 1 | T33901 | SwissTargetPrediction |
| P18031 | PTPN1 | Protein-tyrosine phosphatase 1B | T16347 | SwissTargetPrediction |
| Q07075 | ENPEP | Aminopeptidase A | T31956 | SEA |
| P15090 | FABP4 | Fatty acid binding protein adipocyte | T07217 | SwissTargetPrediction |
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | T86591 | SwissTargetPrediction and SEA |
| Q01469 | FABP5 | Fatty acid binding protein epidermal | T21507 | SwissTargetPrediction |
| Q03181 | PPARD | Peroxisome proliferator-activated receptor delta | T36557 | SwissTargetPrediction and SEA |
| O14842 | FFAR1 | Free fatty acid receptor 1 | T25608 | SwissTargetPrediction |
| P08575 | PTPRC | Leukocyte common antigen | T43115 | SwissTargetPrediction |
| P30307 | CDC25C | Dual specificity phosphatase Cdc25C | T40569 | SwissTargetPrediction and SEA |
| P28845 | HSD11B1 | 11-beta-hydroxysteroid dehydrogenase 1 | T65200 | SwissTargetPrediction |
| P11473 | VDR | Vitamin D receptor | T34234 | SwissTargetPrediction |
| Q8TDU6 | GPBAR1 | G-protein coupled bile acid receptor 1 | T86273 | SwissTargetPrediction |
| P06746 | POLB | DNA polymerase beta (by homology) | T06958 | SwissTargetPrediction and SEA |
| P08254 | MMP3 | Matrix metalloproteinase 3 | T86702 | SwissTargetPrediction and SEA |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | T62815 | SwissTargetPrediction |
| P03956 | MMP1 | Matrix metalloproteinase 1 | T52450 | SwissTargetPrediction |
| P21731 | TBXA2R | Thromboxane A2 receptor | T76198 | SwissTargetPrediction and SEA |
| P10827 | THRA | Thyroid hormone receptor alpha | T79591 | SwissTargetPrediction |
| P10828 | THRB | Thyroid hormone receptor beta-1 | T98933 | SwissTargetPrediction |
| P62993 | GRB2 | Growth factor receptor-bound protein 2 | T30926 | SwissTargetPrediction |
| P42345 | MTOR | Serine/threonine-protein kinase mTOR | T75243 | SwissTargetPrediction |
| Q16539 | MAPK14 | MAP kinase p38 alpha | T65864 | SwissTargetPrediction |
| P06213 | INSR | Insulin receptor | T85435 | SwissTargetPrediction |
| P55072 | VCP | Transitional endoplasmic reticulum ATPase | T12646 | SwissTargetPrediction |
| P24941 | CDK2 | Cyclin-dependent kinase 2 | T70176 | SwissTargetPrediction |
| P36888 | FLT3 | Tyrosine-protein kinase receptor FLT3 | T74312 | SwissTargetPrediction |
| O14965 | AURKA | Serine/threonine-protein kinase Aurora-A | T87675 | SwissTargetPrediction |
| P08172 | CHRM2 | Muscarinic acetylcholine receptor M2 | T46185 | SwissTargetPrediction |
| P37231 | PPARG | Peroxisome proliferator-activated receptor gamma | T58921 | SwissTargetPrediction and SEA |
| P43116 | PTGER2 | Prostanoid EP2 receptor | T38529 | SwissTargetPrediction and SEA |
| P49356 | FNTB | Farnesyl protein transferase | T13127 | SwissTargetPrediction |
| P80365 | HSD11B2 | 11-beta-hydroxysteroid dehydrogenase 2 | T43721 | SwissTargetPrediction |
| P04035 | HMGCR | HMG-CoA reductase | T53585 | SwissTargetPrediction and SEA |
| P11413 | G6PD | Glucose-6-phosphate 1-dehydrogenase | T63484 | SwissTargetPrediction |
| Q15722 | LTB4R | Leukotriene B4 receptor 1 | T59626 | SEA |
| P11137 | MAP2 | Microtubule-associated protein 2 | T23276 | SwissTargetPrediction |
| P20701 | ITGAL | Intercellular adhesion molecule (ICAM-1), Integrin alpha-L/beta-2 | T35640 | SwissTargetPrediction |
| P49841 | GSK3B | Glycogen synthase kinase-3 beta | T70977 | SwissTargetPrediction |
| P32246 | CCR1 | C-C chemokine receptor type 1 | T16016 | SwissTargetPrediction |
| P01375 | TNF | TNF-alpha | T20178 | SwissTargetPrediction |
| P47871 | GCGR | Glucagon receptor | T60182 | SwissTargetPrediction |
| P30556 | AGTR1 | Type-1 angiotensin II receptor | T74456 | SwissTargetPrediction |
| P41229 | KDM5C | Lysine-specific demethylase 5C | T85540 | SwissTargetPrediction |
| P53779 | MAPK10 | c-Jun N-terminal kinase 3 | T85421 | SwissTargetPrediction |
| P52333 | JAK3 | Tyrosine-protein kinase JAK3 | T23172 | SwissTargetPrediction |
| P08263 | GSTA1 | Glutathione S-transferase A1 | T17221 | SEA |
| P47712 | PLA2G4A | Cytosolic phospholipase A2 | T14834 | SwissTargetPrediction |
| P35408 | PTGER4 | Prostanoid EP4 receptor | T18876 | SwissTargetPrediction and SEA |
| P43115 | PTGER3 | Prostanoid EP3 receptor | T85467 | SwissTargetPrediction and SEA |
| P0DJD9 | PGA5 | Pepsin A | T17863 | SEA |
| P30307 | CDC25C | Dual specificity phosphatase Cdc25C | T40569 | SEA |
| Q9Y2K7 | KDM2A | Lysine-specific demethylase 2A | T71949 | SwissTargetPrediction |
| P34995 | PTGER1 | Prostanoid EP1 receptor | T15497 | SwissTargetPrediction and SEA |
| P06493 | CDK1 | Cyclin-dependent kinase 1/cyclin B1 | T49898 | SwissTargetPrediction |
| P25101 | EDNRA | Endothelin receptor ET-A | T23499 | SwissTargetPrediction |
| P04629 | NTRK1 | Nerve growth factor receptor Trk-A | T07173 | SwissTargetPrediction |
| P49840 | GSK3A | Glycogen synthase kinase-3 alpha | T76910 | SwissTargetPrediction |
| Q00535 | CDK5 | Cyclin-dependent kinase 5/CDK5 activator 1 | T20973 | SwissTargetPrediction |
| Q16620 | NTRK2 | Neurotrophic tyrosine kinase receptor type 2 | T84703 | SwissTargetPrediction |
| Q13258 | PTGDR | Prostanoid DP receptor | T68782 | SwissTargetPrediction |
| P10619 | CTSA | Lysosomal protective protein | T37154 | SwissTargetPrediction |
| Q8TDS5 | OXER1 | Oxoeicosanoid receptor 1 | T68834 | SEA |
| P43088 | PTGFR | Prostanoid FP receptor | T75797 | SwissTargetPrediction and SEA |
| P16109 | SELP | P-selectin | T10965 | SEA |
| P14151 | SELL | Leukocyte adhesion molecule-1 | T60526 | SEA |
| O76074 | PDE5A | Phosphodiesterase 5A | T07663 | SwissTargetPrediction |
| P43119 | PTGIR | Prostanoid IP receptor | T99954 | SEA |
| P20839 | IMPDH1 | Inosine-5'-monophosphate dehydrogenase 1 | T40111 | SwissTargetPrediction |
| P12268 | IMPDH2 | Inosine-5'-monophosphate dehydrogenase 2 | T89360 | SwissTargetPrediction |
| Q6ZMT4 | KDM7A | Lysine-specific demethylase 7A/7B | T18784 | SEA |
| P00390 | GSR | Glutathione reductase | T30803 | SEA |
| Q96GD4 | AURKB | Serine/threonine-protein kinase Aurora-B | T46781 | SwissTargetPrediction |
| P24530 | EDNRB | Endothelin receptor ET-B | T92828 | SwissTargetPrediction |
| Q9Y3Q0 | NAALAD2 | NAALADase II | T70036 | SEA |
| Q92820 | GGH | Gamma-glutamyl hydrolase | T71646 | SEA |
| P30307 | CDC25C | Dual specificity phosphatase Cdc25C | T40569 | SEA |
| O00408 | PDE2A | Phosphodiesterase 2A | T77400 | SwissTargetPrediction |
| P40189 | IL6ST | Interleukin-6 receptor subunit beta | T93440 | SEA |
| O75907 | DGAT1 | Diacylglycerol O-acyltransferase 1 | T16688 | SwissTargetPrediction |
| Q13822 | ENPP2 | Autotaxin | T63512 | SEA |
| Q9HBW0 | LPAR2 | Lysophosphatidic acid receptor Edg-4 | T39380 | SEA |
| Q9UPP1 | PHF8 | Histone lysine demethylase PHF8 | T00933 | SwissTargetPrediction |
| Q99500 | S1PR3 | Sphingosine 1-phosphate receptor Edg-3 | T11241 | SEA |
| P13631 | RARG | Retinoic acid receptor gamma | T82146 | SwissTargetPrediction |
| P10826 | RARB | Retinoic acid receptor beta | T61657 | SwissTargetPrediction |
| P43657 | LPAR6 | Lysophosphatidic acid receptor 6 | T13484 | SEA |
| Q9H1C0 | LPAR5 | Lysophosphatidic acid receptor 5 | T18616 | SEA |
| O95136 | S1PR2 | Sphingosine 1-phosphate receptor Edg-5 | T47888 | SEA |
| P18507 | GABRG2 | GABA-A receptor; alpha-6/beta-3/gamma-2 | T08910 | SwissTargetPrediction |
| O95977 | S1PR4 | Sphingosine 1-phosphate receptor Edg-6 | T17523 | SEA |
| O60906 | SMPD2 | Neutral sphingomyelinase | T57316 | SEA |
| Q9UPC5 | GPR34 | Probable G-protein coupled receptor 34 | T73859 | SEA |
| O00398 | P2RY10 | Putative P2Y purinoceptor 10 | T00488 | SEA |
| Q9BXC1 | GPR174 | Probable G-protein coupled receptor 174 | T87661 | SEA |
| Q9UBY5 | LPAR3 | Lysophosphatidic acid receptor Edg-7 | T95923 | SEA |
| Q92633 | LPAR1 | Lysophosphatidic acid receptor Edg-2 | T92640 | SEA |
| Q99677 | LPAR4 | Lysophosphatidic acid receptor 4 | T58130 | SEA |
| P08311 | CTSG | Cathepsin G | T86385 | SEA |
| Q9UJM8 | HAO1 | Hydroxyacid oxidase 1 | T63170 | SwissTargetPrediction and SEA |
| P48546 | GIPR | Gastric inhibitory polypeptide receptor | T41750 | SwissTargetPrediction |
| P43220 | GLP1R | Glucagon-like peptide 1 receptor | T36075 | SwissTargetPrediction |
| O95749 | GGPS1 | Geranyltranstransferase | T86528 | SEA |
| P24557 | TBXAS1 | Thromboxane-A synthase | T78356 | SEA |
| Q04609 | FOLH1 | Glutamate carboxypeptidase II | T97071 | SEA |
| Q4U2R8 | SLC22A6 | Solute carrier family 22 member 6 (by homology) | T70680 | SEA |
| Q9UN88 | GABRQ | GABA(A) receptor theta | T15161 | SEA |
| P78329 | CYP4F2 | Cytochrome P450 4f | T82604 | SEA |
| O60603 | TLR2 | Toll-like receptor 2 | T82078 | SEA |
| O95749 | GGPS1 | Geranyltranstransferase | T86528 | SEA |
| P47870 | GABRB2 | GABA(A) receptor beta-2 | T80387 | SwissTargetPrediction |
| Q92887 | CMOAT | Multidrug resistance-associated protein 2 | T61792 | SEA |
| Q92959 | SLCO2A1 | Prostaglandin transporter | T15518 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T34429 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | P36544 | CHRNA7 |
| T34429 | DI0370 | Schizophrenia | [ICD-11: 6A20] | P36544 | CHRNA7 |
| T92072 | DI0319 | Orthostatic hypotension | [ICD-11: BA21] | P30542 | ADORA1 |
| T65570 | DI0139 | Exposure to noxious substances harmful effect | [ICD-11: NE61] | P07327 | ADH1A |
| T51452 | DI0216 | Intentional self-harm | [ICD-11: PC91] | P47869 | GABRA2 |
| T42446 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | O75899 | GABBR2 |
| T42446 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | O75899 | GABBR2 |
| T42446 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | O75899 | GABBR2 |
| T42446 | DI0290 | Narcolepsy | [ICD-11: 7A20] | O75899 | GABBR2 |
| T03691 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P09960 | LTA4H |
| T38200 | DI0207 | Indeterminate colitis | [ICD-11: DD72] | P48066 | SLC6A11 |
| T42446 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | O75899 | GABBR2 |
| T42446 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | O75899 | GABBR2 |
| T42446 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | O75899 | GABBR2 |
| T42446 | DI0290 | Narcolepsy | [ICD-11: 7A20] | O75899 | GABBR2 |
| T13201 | DI0166 | Glaucoma | [ICD-11: 9C61] | P00915 | CA1 |
| T13201 | DI0372 | Seborrhoeic dermatitis | [ICD-11: EA81] | P00915 | CA1 |
| T80276 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P42336 | PIK3CA |
| T80276 | DI0151 | Follicular lymphoma | [ICD-11: 2A80] | P42336 | PIK3CA |
| T80276 | DI0245 | Malignant haematopoietic neoplasm | [ICD-11: 2B33] | P42336 | PIK3CA |
| T20401 | DI0046 | Bacterial infection | [ICD-11: 1A00-1C4Z] | P00918 | CA2 |
| T20401 | DI0137 | Essential hypertension | [ICD-11: BA00] | P00918 | CA2 |
| T20401 | DI0166 | Glaucoma | [ICD-11: 9C61] | P00918 | CA2 |
| T20401 | DI0175 | Heart failure | [ICD-11: BD10-BD1Z] | P00918 | CA2 |
| T20401 | DI0214 | Insomnia | [ICD-11: 7A00-7A0Z] | P00918 | CA2 |
| T20401 | DI0372 | Seborrhoeic dermatitis | [ICD-11: EA81] | P00918 | CA2 |
| T70680 | DI0167 | Gout | [ICD-11: FA25] | Q4U2R8 | SLC22A6 |
| T70680 | DI0206 | Inborn purine/pyrimidine/nucleotide metabolism error | [ICD-11: 5C55] | Q4U2R8 | SLC22A6 |
| T70680 | DI0310 | Ocular disease | [ICD-11: N.A.] | Q4U2R8 | SLC22A6 |
| T19160 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P14555 | PLA2G2A |
| T51426 | DI0043 | Autoimmune liver disease | [ICD-11: DB96] | Q96RI1 | NR1H4 |
| T51426 | DI0077 | Cholelithiasis | [ICD-11: DC11] | Q96RI1 | NR1H4 |
| T51426 | DI0320 | Osteoarthritis | [ICD-11: FA00-FA05] | Q96RI1 | NR1H4 |
| T35734 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P34913 | EPHX2 |
| T35734 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | P34913 | EPHX2 |
| T76369 | DI0335 | Peroxisomal disease | [ICD-11: 5C57] | P23141 | CES1 |
| T76369 | DI0398 | Synthesis disorder | [ICD-11: 5C52-5C59] | P23141 | CES1 |
| T11211 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P10275 | AR |
| T11211 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P10275 | AR |
| T11211 | DI0021 | Alcoholic liver disease | [ICD-11: DB94] | P10275 | AR |
| T11211 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P10275 | AR |
| T11211 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P10275 | AR |
| T11211 | DI0145 | Female pelvic pain | [ICD-11: GA34] | P10275 | AR |
| T11211 | DI0194 | Hypo-osmolality/hyponatraemia | [ICD-11: 5C72] | P10275 | AR |
| T11211 | DI0237 | Low bone mass disorder | [ICD-11: FB83] | P10275 | AR |
| T11211 | DI0247 | Mammary tumour | [ICD-11: 2C60-2C6Z] | P10275 | AR |
| T11211 | DI0346 | Prostate cancer | [ICD-11: 2C82] | P10275 | AR |
| T11211 | DI0401 | Testicular dysfunction | [ICD-11: 5A81] | P10275 | AR |
| T11754 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | O00519 | FAAH |
| T40016 | DI0016 | Adaptive immunity immunodeficiency | [ICD-11: 4A01] | P04150 | NR3C1 |
| T40016 | DI0022 | Allergic/hypersensitivity disorder | [ICD-11: 4A80-4A8Z] | P04150 | NR3C1 |
| T40016 | DI0037 | Asthma | [ICD-11: CA23] | P04150 | NR3C1 |
| T40016 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P04150 | NR3C1 |
| T40016 | DI0108 | Cushing syndrome | [ICD-11: 5A70] | P04150 | NR3C1 |
| T40016 | DI0280 | Muscular dystrophy | [ICD-11: 8C70] | P04150 | NR3C1 |
| T40016 | DI0314 | Oesophagitis | [ICD-11: DA24] | P04150 | NR3C1 |
| T40016 | DI0339 | Postoperative inflammation | [ICD-11: 1A00-CA43] | P04150 | NR3C1 |
| T40016 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P04150 | NR3C1 |
| T40016 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P04150 | NR3C1 |
| T40016 | DI0432 | Vasomotor/allergic rhinitis | [ICD-11: CA08] | P04150 | NR3C1 |
| T22939 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P06401 | PGR |
| T22939 | DI0100 | Contraceptive management | [ICD-11: QA21] | P06401 | PGR |
| T22939 | DI0255 | Menstrual cycle bleeding disorder | [ICD-11: GA20] | P06401 | PGR |
| T22939 | DI0344 | Preterm labour/delivery | [ICD-11: JB00] | P06401 | PGR |
| T22939 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P06401 | PGR |
| T88452 | DI0037 | Asthma | [ICD-11: CA23] | P08185 | SERPINA6 |
| T88452 | DI0339 | Postoperative inflammation | [ICD-11: 1A00-CA43] | P08185 | SERPINA6 |
| T88452 | DI0362 | Respiratory system disease | [ICD-11: CB40-CB7Z] | P08185 | SERPINA6 |
| T13260 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P11511 | CYP19A1 |
| T13260 | DI0108 | Cushing syndrome | [ICD-11: 5A70] | P11511 | CYP19A1 |
| T09960 | DI0184 | Human immunodeficiency virus disease | [ICD-11: 1C60-1C62] | P51681 | CCR5 |
| T33901 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | Q9UHC9 | NPC1L1 |
| T16347 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P18031 | PTPN1 |
| T16347 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P18031 | PTPN1 |
| T16347 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | P18031 | PTPN1 |
| T16347 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P18031 | PTPN1 |
| T31956 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | Q07075 | ENPEP |
| T86591 | DI0187 | Hyperlipidemia | [ICD-11: 5C80] | Q07869 | PPARA |
| T86591 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | Q07869 | PPARA |
| T86591 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | Q07869 | PPARA |
| T36557 | DI0302 | Non-alcoholic fatty liver disease | [ICD-11: DB92] | Q03181 | PPARD |
| T36557 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | Q03181 | PPARD |
| T25608 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | O14842 | FFAR1 |
| T43115 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P08575 | PTPRC |
| T43115 | DI0414 | Transplanted organ/tissue | [ICD-11: QB63] | P08575 | PTPRC |
| T65200 | DI0210 | Influenza | [ICD-11: 1E30-1E32] | P28845 | HSD11B1 |
| T65200 | DI0239 | Lupus erythematosus | [ICD-11: 4A40] | P28845 | HSD11B1 |
| T65200 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P28845 | HSD11B1 |
| T34234 | DI0083 | Chronic kidney disease | [ICD-11: GB61] | P11473 | VDR |
| T34234 | DI0171 | Hair/hair growth developmental defect | [ICD-11: LC30] | P11473 | VDR |
| T34234 | DI0189 | Hyper-parathyroidism | [ICD-11: 5A51] | P11473 | VDR |
| T34234 | DI0195 | Hypo-parathyroidism | [ICD-11: 5A50] | P11473 | VDR |
| T34234 | DI0266 | Mineral deficiency | [ICD-11: 5B5K] | P11473 | VDR |
| T34234 | DI0351 | Psoriasis | [ICD-11: EA90] | P11473 | VDR |
| T34234 | DI0437 | Vitamin deficiency | [ICD-11: 5B55-5B5F] | P11473 | VDR |
| T86273 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | Q8TDU6 | GPBAR1 |
| T06958 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P06746 | POLB |
| T86702 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | P08254 | MMP3 |
| T86702 | DI0179 | Hepatitis virus infection | [ICD-11: 1E50-1E51] | P08254 | MMP3 |
| T86702 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | P08254 | MMP3 |
| T86702 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P08254 | MMP3 |
| T86702 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | P08254 | MMP3 |
| T86702 | DI0320 | Osteoarthritis | [ICD-11: FA00-FA05] | P08254 | MMP3 |
| T86702 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P08254 | MMP3 |
| T52450 | DI0238 | Lung cancer | [ICD-11: 2C25] | P03956 | MMP1 |
| T76198 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P21731 | TBXA2R |
| T76198 | DI0121 | Diabetic foot ulcer | [ICD-11: BD54] | P21731 | TBXA2R |
| T76198 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | P21731 | TBXA2R |
| T76198 | DI0378 | Sexual dysfunction | [ICD-11: HA00-HA01] | P21731 | TBXA2R |
| T79591 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | P10827 | THRA |
| T79591 | DI0197 | Hypo-thyroidism | [ICD-11: 5A00] | P10827 | THRA |
| T98933 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | P10828 | THRB |
| T30926 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P62993 | GRB2 |
| T30926 | DI0245 | Malignant haematopoietic neoplasm | [ICD-11: 2B33] | P62993 | GRB2 |
| T30926 | DI0250 | Mature B-cell lymphoma | [ICD-11: 2A85] | P62993 | GRB2 |
| T30926 | DI0284 | Myelodysplastic syndrome | [ICD-11: 2A37] | P62993 | GRB2 |
| T30926 | DI0286 | Myeloproliferative neoplasm | [ICD-11: 2A20] | P62993 | GRB2 |
| T75243 | DI0036 | Arteries/arterioles disorder | [ICD-11: BD52] | P42345 | MTOR |
| T75243 | DI0085 | Chronic myelomonocytic leukaemia | [ICD-11: 2A40] | P42345 | MTOR |
| T75243 | DI0274 | Multiple myeloma | [ICD-11: 2A83] | P42345 | MTOR |
| T75243 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P42345 | MTOR |
| T75243 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P42345 | MTOR |
| T75243 | DI0413 | Transplant rejection | [ICD-11: NE84] | P42345 | MTOR |
| T65864 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | Q16539 | MAPK14 |
| T65864 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | Q16539 | MAPK14 |
| T65864 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | Q16539 | MAPK14 |
| T65864 | DI0437 | Vitamin deficiency | [ICD-11: 5B55-5B5F] | Q16539 | MAPK14 |
| T85435 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P06213 | INSR |
| T85435 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P06213 | INSR |
| T12646 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P55072 | VCP |
| T12646 | DI0274 | Multiple myeloma | [ICD-11: 2A83] | P55072 | VCP |
| T12646 | DI0284 | Myelodysplastic syndrome | [ICD-11: 2A37] | P55072 | VCP |
| T12646 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P55072 | VCP |
| T70176 | DI0060 | Brain cancer | [ICD-11: 2A00] | P24941 | CDK2 |
| T70176 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P24941 | CDK2 |
| T70176 | DI0238 | Lung cancer | [ICD-11: 2C25] | P24941 | CDK2 |
| T70176 | DI0241 | Lymphoma | [ICD-11: 2A80-2A86] | P24941 | CDK2 |
| T70176 | DI0245 | Malignant haematopoietic neoplasm | [ICD-11: 2B33] | P24941 | CDK2 |
| T70176 | DI0303 | Non-small-cell lung cancer | [ICD-11: 2C25] | P24941 | CDK2 |
| T70176 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P24941 | CDK2 |
| T70176 | DI0406 | Thymoma | [ICD-11: 2C27] | P24941 | CDK2 |
| T74312 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P36888 | FLT3 |
| T74312 | DI0058 | Bone/articular cartilage neoplasm | [ICD-11: 2F7B] | P36888 | FLT3 |
| T74312 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P36888 | FLT3 |
| T74312 | DI0184 | Human immunodeficiency virus disease | [ICD-11: 1C60-1C62] | P36888 | FLT3 |
| T74312 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | P36888 | FLT3 |
| T74312 | DI0248 | Mastocytosis | [ICD-11: 2A21] | P36888 | FLT3 |
| T74312 | DI0250 | Mature B-cell lymphoma | [ICD-11: 2A85] | P36888 | FLT3 |
| T74312 | DI0286 | Myeloproliferative neoplasm | [ICD-11: 2A20] | P36888 | FLT3 |
| T87675 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | O14965 | AURKA |
| T87675 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | O14965 | AURKA |
| T46185 | DI0037 | Asthma | [ICD-11: CA23] | P08172 | CHRM2 |
| T46185 | DI0166 | Glaucoma | [ICD-11: 9C61] | P08172 | CHRM2 |
| T46185 | DI0278 | Muscle disorder | [ICD-11: FB32-FB3Z] | P08172 | CHRM2 |
| T46185 | DI0333 | Peptic ulcer | [ICD-11: DA61] | P08172 | CHRM2 |
| T46185 | DI0362 | Respiratory system disease | [ICD-11: CB40-CB7Z] | P08172 | CHRM2 |
| T46185 | DI0371 | Sebaceous gland disorder | [ICD-11: ED91] | P08172 | CHRM2 |
| T58921 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P37231 | PPARG |
| T58921 | DI0025 | Alzheimer disease | [ICD-11: 8A20] | P37231 | PPARG |
| T58921 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P37231 | PPARG |
| T38529 | DI0003 | Abortion | [ICD-11: JA00] | P43116 | PTGER2 |
| T38529 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P43116 | PTGER2 |
| T38529 | DI0121 | Diabetic foot ulcer | [ICD-11: BD54] | P43116 | PTGER2 |
| T38529 | DI0166 | Glaucoma | [ICD-11: 9C61] | P43116 | PTGER2 |
| T38529 | DI0356 | Pulmonary hypertension | [ICD-11: BB01] | P43116 | PTGER2 |
| T38529 | DI0378 | Sexual dysfunction | [ICD-11: HA00-HA01] | P43116 | PTGER2 |
| T38529 | DI0413 | Transplant rejection | [ICD-11: NE84] | P43116 | PTGER2 |
| T13127 | DI0342 | Premature ageing appearance | [ICD-11: LD2B] | P49356 | FNTB |
| T43721 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P80365 | HSD11B2 |
| T53585 | DI0070 | Cardiovascular disease | [ICD-11: BA00-BE2Z] | P04035 | HMGCR |
| T53585 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P04035 | HMGCR |
| T53585 | DI0128 | Dyslipidemia | [ICD-11: 5C80-5C81] | P04035 | HMGCR |
| T53585 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | P04035 | HMGCR |
| T53585 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P04035 | HMGCR |
| T53585 | DI0287 | Myocardial infarction | [ICD-11: BA41-BA43] | P04035 | HMGCR |
| T53585 | DI0324 | Pain | [ICD-11: MG30-MG3Z] | P04035 | HMGCR |
| T63484 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P11413 | G6PD |
| T59626 | DI0184 | Human immunodeficiency virus disease | [ICD-11: 1C60-1C62] | Q15722 | LTB4R |
| T59626 | DI0355 | Pulmonary disease | [ICD-11: 1B10-1F85] | Q15722 | LTB4R |
| T59626 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | Q15722 | LTB4R |
| T23276 | DI0036 | Arteries/arterioles disorder | [ICD-11: BD52] | P11137 | MAP2 |
| T23276 | DI0252 | Melanoma | [ICD-11: 2C30] | P11137 | MAP2 |
| T23276 | DI0326 | Pancreatic cancer | [ICD-11: 2C10] | P11137 | MAP2 |
| T23276 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P11137 | MAP2 |
| T35640 | DI0351 | Psoriasis | [ICD-11: EA90] | P20701 | ITGAL |
| T35640 | DI0436 | Visual system disease | [ICD-11: 9E1Z] | P20701 | ITGAL |
| T70977 | DI0288 | Myotonic disorder | [ICD-11: 8C71] | P49841 | GSK3B |
| T16016 | DI0120 | Diabetes mellitus | [ICD-11: 5A10] | P32246 | CCR1 |
| T16016 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P32246 | CCR1 |
| T20178 | DI0035 | Arterial occlusive disease | [ICD-11: BD40] | P01375 | TNF |
| T20178 | DI0274 | Multiple myeloma | [ICD-11: 2A83] | P01375 | TNF |
| T20178 | DI0351 | Psoriasis | [ICD-11: EA90] | P01375 | TNF |
| T20178 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P01375 | TNF |
| T60182 | DI0193 | Hypo-glycaemia | [ICD-11: 5A41] | P47871 | GCGR |
| T74456 | DI0137 | Essential hypertension | [ICD-11: BA00] | P30556 | AGTR1 |
| T74456 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | P30556 | AGTR1 |
| T74456 | DI0373 | Secondary hypertension | [ICD-11: BA04] | P30556 | AGTR1 |
| T74456 | DI0425 | Urinary system clinical symptom | [ICD-11: MF8Y] | P30556 | AGTR1 |
| T85421 | DI0125 | Dissociative neurological symptom disorder | [ICD-11: 6B60] | P53779 | MAPK10 |
| T23172 | DI0023 | Alopecia | [ICD-11: ED70] | P52333 | JAK3 |
| T23172 | DI0039 | Atopic eczema | [ICD-11: EA80] | P52333 | JAK3 |
| T23172 | DI0286 | Myeloproliferative neoplasm | [ICD-11: 2A20] | P52333 | JAK3 |
| T23172 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P52333 | JAK3 |
| T14834 | DI0039 | Atopic eczema | [ICD-11: EA80] | P47712 | PLA2G4A |
| T18876 | DI0037 | Asthma | [ICD-11: CA23] | P35408 | PTGER4 |
| T18876 | DI0175 | Heart failure | [ICD-11: BD10-BD1Z] | P35408 | PTGER4 |
| T18876 | DI0264 | Migraine | [ICD-11: 8A80] | P35408 | PTGER4 |
| T18876 | DI0303 | Non-small-cell lung cancer | [ICD-11: 2C25] | P35408 | PTGER4 |
| T18876 | DI0324 | Pain | [ICD-11: MG30-MG3Z] | P35408 | PTGER4 |
| T18876 | DI0360 | Rectum cancer | [ICD-11: 2B92] | P35408 | PTGER4 |
| T18876 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P35408 | PTGER4 |
| T18876 | DI0414 | Transplanted organ/tissue | [ICD-11: QB63] | P35408 | PTGER4 |
| T85467 | DI0166 | Glaucoma | [ICD-11: 9C61] | P43115 | PTGER3 |
| T85467 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P43115 | PTGER3 |
| T85467 | DI0414 | Transplanted organ/tissue | [ICD-11: QB63] | P43115 | PTGER3 |
| T15497 | DI0405 | Thrombosis | [ICD-11: DB61-GB90] | P34995 | PTGER1 |
| T49898 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P06493 | CDK1 |
| T49898 | DI0238 | Lung cancer | [ICD-11: 2C25] | P06493 | CDK1 |
| T49898 | DI0245 | Malignant haematopoietic neoplasm | [ICD-11: 2B33] | P06493 | CDK1 |
| T49898 | DI0250 | Mature B-cell lymphoma | [ICD-11: 2A85] | P06493 | CDK1 |
| T49898 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P06493 | CDK1 |
| T23499 | DI0070 | Cardiovascular disease | [ICD-11: BA00-BE2Z] | P25101 | EDNRA |
| T23499 | DI0356 | Pulmonary hypertension | [ICD-11: BB01] | P25101 | EDNRA |
| T23499 | DI0425 | Urinary system clinical symptom | [ICD-11: MF8Y] | P25101 | EDNRA |
| T07173 | DI0303 | Non-small-cell lung cancer | [ICD-11: 2C25] | P04629 | NTRK1 |
| T07173 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P04629 | NTRK1 |
| T76910 | DI0134 | Epilepsy/seizure | [ICD-11: 8A61-8A6Z] | P49840 | GSK3A |
| T20973 | DI0308 | Obesity | [ICD-11: 5B80-5B81] | Q00535 | CDK5 |
| T84703 | DI0303 | Non-small-cell lung cancer | [ICD-11: 2C25] | Q16620 | NTRK2 |
| T84703 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | Q16620 | NTRK2 |
| T68782 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | Q13258 | PTGDR |
| T37154 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | P10619 | CTSA |
| T75797 | DI0003 | Abortion | [ICD-11: JA00] | P43088 | PTGFR |
| T75797 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P43088 | PTGFR |
| T75797 | DI0166 | Glaucoma | [ICD-11: 9C61] | P43088 | PTGFR |
| T10965 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P16109 | SELP |
| T10965 | DI0381 | Sickle-cell disorder | [ICD-11: 3A51] | P16109 | SELP |
| T60526 | DI0037 | Asthma | [ICD-11: CA23] | P14151 | SELL |
| T60526 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P14151 | SELL |
| T07663 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | O76074 | PDE5A |
| T07663 | DI0213 | Innate/adaptive immunodeficiency | [ICD-11: 4A00] | O76074 | PDE5A |
| T07663 | DI0378 | Sexual dysfunction | [ICD-11: HA00-HA01] | O76074 | PDE5A |
| T07663 | DI0411 | Tonus and reflex abnormality | [ICD-11: MB47] | O76074 | PDE5A |
| T99954 | DI0003 | Abortion | [ICD-11: JA00] | P43119 | PTGIR |
| T99954 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P43119 | PTGIR |
| T99954 | DI0356 | Pulmonary hypertension | [ICD-11: BB01] | P43119 | PTGIR |
| T40111 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P20839 | IMPDH1 |
| T40111 | DI0179 | Hepatitis virus infection | [ICD-11: 1E50-1E51] | P20839 | IMPDH1 |
| T40111 | DI0250 | Mature B-cell lymphoma | [ICD-11: 2A85] | P20839 | IMPDH1 |
| T40111 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | P20839 | IMPDH1 |
| T40111 | DI0413 | Transplant rejection | [ICD-11: NE84] | P20839 | IMPDH1 |
| T89360 | DI0413 | Transplant rejection | [ICD-11: NE84] | P12268 | IMPDH2 |
| T30803 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | P00390 | GSR |
| T46781 | DI0009 | Acute diabete complication | [ICD-11: 5A2Y] | Q96GD4 | AURKB |
| T46781 | DI0391 | Solid tumour/cancer | [ICD-11: 2A00-2F9Z] | Q96GD4 | AURKB |
| T92828 | DI0070 | Cardiovascular disease | [ICD-11: BA00-BE2Z] | P24530 | EDNRB |
| T92828 | DI0356 | Pulmonary hypertension | [ICD-11: BB01] | P24530 | EDNRB |
| T77400 | DI0206 | Inborn purine/pyrimidine/nucleotide metabolism error | [ICD-11: 5C55] | O00408 | PDE2A |
| T77400 | DI0207 | Indeterminate colitis | [ICD-11: DD72] | O00408 | PDE2A |
| T77400 | DI0218 | Irritable bowel syndrome | [ICD-11: DD91] | O00408 | PDE2A |
| T77400 | DI0270 | Mood disorder | [ICD-11: 6A60-6E23] | O00408 | PDE2A |
| T93440 | DI0366 | Rheumatoid arthritis | [ICD-11: FA20] | P40189 | IL6ST |
| T16688 | DI0188 | Hyper-lipoproteinaemia | [ICD-11: 5C80] | O75907 | DGAT1 |
| T63512 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q13822 | ENPP2 |
| T11241 | DI0062 | Breast cancer | [ICD-11: 2C60-2C6Y] | Q99500 | S1PR3 |
| T82146 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P13631 | RARG |
| T82146 | DI0012 | Acute myeloid leukaemia | [ICD-11: 2A60] | P13631 | RARG |
| T82146 | DI0225 | Kaposi sarcoma | [ICD-11: 2B57] | P13631 | RARG |
| T82146 | DI0277 | Muscle calcification/ossification | [ICD-11: FB31] | P13631 | RARG |
| T82146 | DI0351 | Psoriasis | [ICD-11: EA90] | P13631 | RARG |
| T61657 | DI0225 | Kaposi sarcoma | [ICD-11: 2B57] | P10826 | RARB |
| T47888 | DI0419 | Ulcerative colitis | [ICD-11: DD71] | O95136 | S1PR2 |
| T08910 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | P18507 | GABRG2 |
| T08910 | DI0256 | Mental/behavioural/neurodevelopmental disorder | [ICD-11: 6E20-6E8Z] | P18507 | GABRG2 |
| T08910 | DI0411 | Tonus and reflex abnormality | [ICD-11: MB47] | P18507 | GABRG2 |
| T95923 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q9UBY5 | LPAR3 |
| T95923 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q9UBY5 | LPAR3 |
| T92640 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q92633 | LPAR1 |
| T92640 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q92633 | LPAR1 |
| T92640 | DI0351 | Psoriasis | [ICD-11: EA90] | Q92633 | LPAR1 |
| T92640 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q92633 | LPAR1 |
| T86385 | DI0086 | Chronic obstructive pulmonary disease | [ICD-11: CA22] | P08311 | CTSG |
| T63170 | DI0201 | Inborn carbohydrate metabolism error | [ICD-11: 5C51] | Q9UJM8 | HAO1 |
| T41750 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P48546 | GIPR |
| T36075 | DI0417 | Type 2 diabetes mellitus | [ICD-11: 5A11] | P43220 | GLP1R |
| T36075 | DI0418 | Type-1/2 diabete | [ICD-11: 5A10-5A11] | P43220 | GLP1R |
| T86528 | DI0057 | Bone paget disease | [ICD-11: FB85] | O95749 | GGPS1 |
| T86528 | DI0237 | Low bone mass disorder | [ICD-11: FB83] | O95749 | GGPS1 |
| T86528 | DI0267 | Mineral excesses | [ICD-11: 5B91] | O95749 | GGPS1 |
| T86528 | DI0281 | Musculoskeletal disorder | [ICD-11: FA00-FC0Z] | O95749 | GGPS1 |
| T78356 | DI0030 | Angina pectoris | [ICD-11: BA40] | P24557 | TBXAS1 |
| T97071 | DI0122 | Diagnostic imaging | [ICD-11: N.A.] | Q04609 | FOLH1 |
| T97071 | DI0346 | Prostate cancer | [ICD-11: 2C82] | Q04609 | FOLH1 |
| T70680 | DI0167 | Gout | [ICD-11: FA25] | Q4U2R8 | SLC22A6 |
| T70680 | DI0206 | Inborn purine/pyrimidine/nucleotide metabolism error | [ICD-11: 5C55] | Q4U2R8 | SLC22A6 |
| T70680 | DI0310 | Ocular disease | [ICD-11: N.A.] | Q4U2R8 | SLC22A6 |
| T82078 | DI0346 | Prostate cancer | [ICD-11: 2C82] | O60603 | TLR2 |
| T86528 | DI0057 | Bone paget disease | [ICD-11: FB85] | O95749 | GGPS1 |
| T86528 | DI0237 | Low bone mass disorder | [ICD-11: FB83] | O95749 | GGPS1 |
| T86528 | DI0267 | Mineral excesses | [ICD-11: 5B91] | O95749 | GGPS1 |
| T86528 | DI0281 | Musculoskeletal disorder | [ICD-11: FA00-FC0Z] | O95749 | GGPS1 |
| T80387 | DI0117 | Depression | [ICD-11: 6A70-6A7Z] | P47870 | GABRB2 |
| T80387 | DI0214 | Insomnia | [ICD-11: 7A00-7A0Z] | P47870 | GABRB2 |
| T80387 | DI0256 | Mental/behavioural/neurodevelopmental disorder | [ICD-11: 6E20-6E8Z] | P47870 | GABRB2 |
| T80387 | DI0411 | Tonus and reflex abnormality | [ICD-11: MB47] | P47870 | GABRB2 |