Compound details
Ervadivaricatine A
| Compound ID | CDAMM00425 |
|---|---|
| Common name | Ervadivaricatine A | IUPAC name | methyl 15-ethyl-12-[16-ethyl-8-methoxy-18-(2-methoxy-2-oxoethyl)-2,12-diazapentacyclo[15.1.1.02,15.05,13.06,11]nonadeca-5(13),6,8,10-tetraen-9-yl]-17-methyl-10,17-diazatetracyclo[12.3.1.03,11.04,9]octadeca-3(11),4,6,8-tetraene-18-carboxylate |
| Molecular formula | C43H54N4O5 |
| Retention time | 45.616 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 707.408 | Theoretical mz | 707.417 |
| Error | 12.15 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 5.33 |
| Inchi key | ABJYICNGIWOJHA-UHFFFAOYSA-N |
|---|---|
| Smiles | CCC1CN(C2CC3=C(C(CC1C2C(=O)OC)C4=C(C=C5C6=C(CC7C(C8CC(C8CC(=O)OC)N7CC6)CC)NC5=C4)OC)NC9=CC=CC=C39)C |
| Superclass | Alkaloids and derivatives |
| Class | Ibogan-type alkaloids |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T62974 | DI0087 | Chronic pain | [ICD-11: MG30] | P31391 | SSTR4 |
| T62974 | DI0179 | Hepatitis virus infection | [ICD-11: 1E50-1E51] | P31391 | SSTR4 |
| T16633 | DI0108 | Cushing syndrome | [ICD-11: 5A70] | P30872 | SSTR1 |
| T16633 | DI0395 | Stomach cancer | [ICD-11: 2B72] | P30872 | SSTR1 |