Compound details
2-hydroxy-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propyl octadeca-6,9,12,15-tetraenoate
| Compound ID | CDAMM00205 |
|---|---|
| Common name | 2-hydroxy-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propyl octadeca-6,9,12,15-tetraenoate | IUPAC name | [2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] octadeca-6,9,12,15-tetraenoate |
| Molecular formula | C27H44O9 |
| Retention time | 31.64 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 513.305 | Theoretical mz | 513.306 |
| Error | 0.77 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 5.5077 |
| Inchi key | OBLUCMMNMFITHB-QLTJWRQVNA-N |
|---|---|
| Smiles | CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COC1C(C(C(C(O1)CO)O)O)O)O |
| Superclass | Lipids and lipid-like molecules |
| Class | Glycerolipids |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|---|---|---|---|
| P10253 | GAA | Lysosomal alpha-glucosidase (by homology) | T31514 | SEA |
| O00519 | FAAH | Anandamide amidohydrolase | T11754 | SEA |
| P15692 | VEGFA | Vascular endothelial growth factor A | T20761 | SEA |
| P05230 | FGF1 | Acidic fibroblast growth factor | T18639 | SEA |
| P09038 | FGF2 | Basic fibroblast growth factor | T31621 | SEA |
| Q8TDS5 | OXER1 | Oxoeicosanoid receptor 1 | T68834 | SEA |
| P16109 | SELP | P-selectin | T10965 | SEA |
| P14151 | SELL | Leukocyte adhesion molecule-1 | T60526 | SEA |
| P60568 | IL2 | Interleukin-2 | T61698 | SEA |
| P17931 | LGALS3 | Galectin-3 | T72038 | SEA |
| Q9HBW0 | LPAR2 | Lysophosphatidic acid receptor Edg-4 | T39380 | SEA |
| P43657 | LPAR6 | Lysophosphatidic acid receptor 6 | T13484 | SEA |
| Q9H1C0 | LPAR5 | Lysophosphatidic acid receptor 5 | T18616 | SEA |
| Q9NZ08 | ERAP1 | Endoplasmic reticulum aminopeptidase 1 | T72849 | SEA |
| Q9UPC5 | GPR34 | Probable G-protein coupled receptor 34 | T73859 | SEA |
| O00398 | P2RY10 | Putative P2Y purinoceptor 10 | T00488 | SEA |
| Q9BXC1 | GPR174 | Probable G-protein coupled receptor 174 | T87661 | SEA |
| Q9UBY5 | LPAR3 | Lysophosphatidic acid receptor Edg-7 | T95923 | SEA |
| Q92633 | LPAR1 | Lysophosphatidic acid receptor Edg-2 | T92640 | SEA |
| Q99677 | LPAR4 | Lysophosphatidic acid receptor 4 | T58130 | SEA |
| O60603 | TLR2 | Toll-like receptor 2 | T82078 | SEA |
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|---|---|---|---|---|
| T31514 | DI0201 | Inborn carbohydrate metabolism error | [ICD-11: 5C51] | P10253 | GAA |
| T11754 | DI0101 | Corneal disease | [ICD-11: 9A76-9A78] | O00519 | FAAH |
| T20761 | DI0095 | Colorectal cancer | [ICD-11: 2B91] | P15692 | VEGFA |
| T20761 | DI0365 | Retinopathy | [ICD-11: 9B71] | P15692 | VEGFA |
| T20761 | DI0430 | Vascular system developmental anomaly | [ICD-11: LA90] | P15692 | VEGFA |
| T18639 | DI0081 | Chronic arterial occlusive disease | [ICD-11: BD4Z] | P05230 | FGF1 |
| T18639 | DI0102 | Coronary atherosclerosis | [ICD-11: BA52] | P05230 | FGF1 |
| T31621 | DI0005 | Acne vulgaris | [ICD-11: ED80] | P09038 | FGF2 |
| T10965 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P16109 | SELP |
| T10965 | DI0381 | Sickle-cell disorder | [ICD-11: 3A51] | P16109 | SELP |
| T60526 | DI0037 | Asthma | [ICD-11: CA23] | P14151 | SELL |
| T60526 | DI0088 | Circulatory system disease | [ICD-11: BE2Z] | P14151 | SELL |
| T61698 | DI0275 | Multiple sclerosis | [ICD-11: 8A40] | P60568 | IL2 |
| T61698 | DI0361 | Renal cell carcinoma | [ICD-11: 2C90] | P60568 | IL2 |
| T72038 | DI0190 | Hypertension | [ICD-11: BA00-BA04] | P17931 | LGALS3 |
| T72038 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | P17931 | LGALS3 |
| T72038 | DI0252 | Melanoma | [ICD-11: 2C30] | P17931 | LGALS3 |
| T72038 | DI0302 | Non-alcoholic fatty liver disease | [ICD-11: DB92] | P17931 | LGALS3 |
| T72038 | DI0351 | Psoriasis | [ICD-11: EA90] | P17931 | LGALS3 |
| T95923 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q9UBY5 | LPAR3 |
| T95923 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q9UBY5 | LPAR3 |
| T92640 | DI0146 | Fibrosis | [ICD-11: GA14-GC01] | Q92633 | LPAR1 |
| T92640 | DI0199 | Idiopathic interstitial pneumonitis | [ICD-11: CB03] | Q92633 | LPAR1 |
| T92640 | DI0351 | Psoriasis | [ICD-11: EA90] | Q92633 | LPAR1 |
| T92640 | DI0399 | Systemic sclerosis | [ICD-11: 4A42] | Q92633 | LPAR1 |
| T82078 | DI0346 | Prostate cancer | [ICD-11: 2C82] | O60603 | TLR2 |