Compound details
Choline sulfate
| Compound ID | CDAMM00050 |
|---|---|
| Common name | Choline sulfate | IUPAC name | 2-(trimethylazaniumyl)ethyl sulfate |
| Molecular formula | C5H13NO4S |
| Retention time | 6.68 |
|---|---|
| Adduct | [M+H]+ |
| Actual mz | 184.063 | Theoretical mz | 184.064 |
| Error | 4.34 |
| Ionizaton mode | Positive |
| Instrument type | LC-MS/MS-QTOF, spectrum predicted by MS-DIAL v4.9 integrated with MS-FINDER 3.60 |
| Score | 5.2608 |
| Inchi key | WXCQAWGXWVRCGP-UHFFFAOYSA-N |
|---|---|
| Smiles | C[N+](C)(C)CCOS(=O)(=O)[O-] |
| Superclass | Organic acids and derivatives |
| Class | Organic sulfuric acids and derivatives |
| Uniprot ID | Gene name | Target name | TTD_ID | Prediction source |
|---|
| TTD_ID | Disease_ID | Disease name | ICD_11 | Uniprot ID | Gene names |
|---|